About ethyl 8-(difluoromethyl)-1,4-dioxaspiro[4.5]decane-8-carboxylate
ethyl 8-(difluoromethyl)-1,4-dioxaspiro[4.5]decane-8-carboxylate (PubChem CID 166771857) has the molecular formula C12H18F2O4
and a molecular weight of 264.27 g/mol. Its IUPAC name is ethyl 8-(difluoromethyl)-1,4-dioxaspiro[4.5]decane-8-carboxylate.
Molecular Properties
| Compound Name | ethyl 8-(difluoromethyl)-1,4-dioxaspiro[4.5]decane-8-carboxylate |
| PubChem CID | 166771857 |
| Molecular Formula | C12H18F2O4 |
| Molecular Weight | 264.27 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | ethyl 8-(difluoromethyl)-1,4-dioxaspiro[4.5]decane-8-carboxylate |
| SMILES | CCOC(=O)C1(C(F)F)CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C12H18F2O4/c1-2-16-10(15)11(9(13)14)3-5-12(6-4-11)17-7-8-18-12/h9H,2-8H2,1H3 |
| InChIKey | SAOCSBMTQFQOFY-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.27 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 8-(difluoromethyl)-1,4-dioxaspiro[4.5]decane-8-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 8-(difluoromethyl)-1,4-dioxaspiro[4.5]decane-8-carboxylate?
The IUPAC name of ethyl 8-(difluoromethyl)-1,4-dioxaspiro[4.5]decane-8-carboxylate (CID 166771857) is ethyl 8-(difluoromethyl)-1,4-dioxaspiro[4.5]decane-8-carboxylate.
What is the SMILES notation for ethyl 8-(difluoromethyl)-1,4-dioxaspiro[4.5]decane-8-carboxylate?
The canonical SMILES for ethyl 8-(difluoromethyl)-1,4-dioxaspiro[4.5]decane-8-carboxylate is CCOC(=O)C1(C(F)F)CCC2(CC1)OCCO2.
What is the InChIKey of ethyl 8-(difluoromethyl)-1,4-dioxaspiro[4.5]decane-8-carboxylate?
The InChIKey is SAOCSBMTQFQOFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18F2O4/c1-2-16-10(15)11(9(13)14)3-5-12(6-4-11)17-7-8-18-12/h9H,2-8H2,1H3.
What are the key properties of ethyl 8-(difluoromethyl)-1,4-dioxaspiro[4.5]decane-8-carboxylate?
ethyl 8-(difluoromethyl)-1,4-dioxaspiro[4.5]decane-8-carboxylate has a molecular weight of 264.27 g/mol, XLogP of 2.12, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 8-(difluoromethyl)-1,4-dioxaspiro[4.5]decane-8-carboxylate is sourced from PubChem (CID 166771857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).