About N-[2-(3-chlorophenyl)-2,2-difluoroethyl]prop-2-enamide
N-[2-(3-chlorophenyl)-2,2-difluoroethyl]prop-2-enamide (PubChem CID 166772612) has the molecular formula C11H10ClF2NO
and a molecular weight of 245.66 g/mol. Its IUPAC name is N-[2-(3-chlorophenyl)-2,2-difluoroethyl]prop-2-enamide.
Molecular Properties
| Compound Name | N-[2-(3-chlorophenyl)-2,2-difluoroethyl]prop-2-enamide |
| PubChem CID | 166772612 |
| Molecular Formula | C11H10ClF2NO |
| Molecular Weight | 245.66 g/mol |
| Exact Mass | 245.04 |
| IUPAC Name | N-[2-(3-chlorophenyl)-2,2-difluoroethyl]prop-2-enamide |
| SMILES | C=CC(=O)NCC(F)(F)c1cccc(Cl)c1 |
| InChI | InChI=1S/C11H10ClF2NO/c1-2-10(16)15-7-11(13,14)8-4-3-5-9(12)6-8/h2-6H,1,7H2,(H,15,16) |
| InChIKey | PUKWAXCBSVIMKB-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.66 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(3-chlorophenyl)-2,2-difluoroethyl]prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(3-chlorophenyl)-2,2-difluoroethyl]prop-2-enamide?
The IUPAC name of N-[2-(3-chlorophenyl)-2,2-difluoroethyl]prop-2-enamide (CID 166772612) is N-[2-(3-chlorophenyl)-2,2-difluoroethyl]prop-2-enamide.
What is the SMILES notation for N-[2-(3-chlorophenyl)-2,2-difluoroethyl]prop-2-enamide?
The canonical SMILES for N-[2-(3-chlorophenyl)-2,2-difluoroethyl]prop-2-enamide is C=CC(=O)NCC(F)(F)c1cccc(Cl)c1.
What is the InChIKey of N-[2-(3-chlorophenyl)-2,2-difluoroethyl]prop-2-enamide?
The InChIKey is PUKWAXCBSVIMKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10ClF2NO/c1-2-10(16)15-7-11(13,14)8-4-3-5-9(12)6-8/h2-6H,1,7H2,(H,15,16).
What are the key properties of N-[2-(3-chlorophenyl)-2,2-difluoroethyl]prop-2-enamide?
N-[2-(3-chlorophenyl)-2,2-difluoroethyl]prop-2-enamide has a molecular weight of 245.66 g/mol, XLogP of 2.73, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(3-chlorophenyl)-2,2-difluoroethyl]prop-2-enamide is sourced from PubChem (CID 166772612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).