About tert-butyl 3-[4-(3,4-difluorophenyl)-8-hydroxy-3-(oxan-4-yl)isoquinolin-1-yl]benzoate
tert-butyl 3-[4-(3,4-difluorophenyl)-8-hydroxy-3-(oxan-4-yl)isoquinolin-1-yl]benzoate (PubChem CID 166773188) has the molecular formula C31H29F2NO4
and a molecular weight of 517.57 g/mol. Its IUPAC name is tert-butyl 3-[4-(3,4-difluorophenyl)-8-hydroxy-3-(oxan-4-yl)isoquinolin-1-yl]benzoate.
Molecular Properties
| Compound Name | tert-butyl 3-[4-(3,4-difluorophenyl)-8-hydroxy-3-(oxan-4-yl)isoquinolin-1-yl]benzoate |
| PubChem CID | 166773188 |
| Molecular Formula | C31H29F2NO4 |
| Molecular Weight | 517.57 g/mol |
| Exact Mass | 517.21 |
| IUPAC Name | tert-butyl 3-[4-(3,4-difluorophenyl)-8-hydroxy-3-(oxan-4-yl)isoquinolin-1-yl]benzoate |
| SMILES | CC(C)(C)OC(=O)c1cccc(-c2nc(C3CCOCC3)c(-c3ccc(F)c(F)c3)c3cccc(O)c23)c1 |
| InChI | InChI=1S/C31H29F2NO4/c1-31(2,3)38-30(36)21-7-4-6-20(16-21)29-27-22(8-5-9-25(27)35)26(19-10-11-23(32)24(33)17-19)28(34-29)18-12-14-37-15-13-18/h4-11,16-18,35H,12-15H2,1-3H3 |
| InChIKey | OEZABGVVQHZBCD-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 517.57 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl 3-[4-(3,4-difluorophenyl)-8-hydroxy-3-(oxan-4-yl)isoquinolin-1-yl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 3-[4-(3,4-difluorophenyl)-8-hydroxy-3-(oxan-4-yl)isoquinolin-1-yl]benzoate?
The IUPAC name of tert-butyl 3-[4-(3,4-difluorophenyl)-8-hydroxy-3-(oxan-4-yl)isoquinolin-1-yl]benzoate (CID 166773188) is tert-butyl 3-[4-(3,4-difluorophenyl)-8-hydroxy-3-(oxan-4-yl)isoquinolin-1-yl]benzoate.
What is the SMILES notation for tert-butyl 3-[4-(3,4-difluorophenyl)-8-hydroxy-3-(oxan-4-yl)isoquinolin-1-yl]benzoate?
The canonical SMILES for tert-butyl 3-[4-(3,4-difluorophenyl)-8-hydroxy-3-(oxan-4-yl)isoquinolin-1-yl]benzoate is CC(C)(C)OC(=O)c1cccc(-c2nc(C3CCOCC3)c(-c3ccc(F)c(F)c3)c3cccc(O)c23)c1.
What is the InChIKey of tert-butyl 3-[4-(3,4-difluorophenyl)-8-hydroxy-3-(oxan-4-yl)isoquinolin-1-yl]benzoate?
The InChIKey is OEZABGVVQHZBCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H29F2NO4/c1-31(2,3)38-30(36)21-7-4-6-20(16-21)29-27-22(8-5-9-25(27)35)26(19-10-11-23(32)24(33)17-19)28(34-29)18-12-14-37-15-13-18/h4-11,16-18,35H,12-15H2,1-3H3.
What are the key properties of tert-butyl 3-[4-(3,4-difluorophenyl)-8-hydroxy-3-(oxan-4-yl)isoquinolin-1-yl]benzoate?
tert-butyl 3-[4-(3,4-difluorophenyl)-8-hydroxy-3-(oxan-4-yl)isoquinolin-1-yl]benzoate has a molecular weight of 517.57 g/mol, XLogP of 7.40, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 3-[4-(3,4-difluorophenyl)-8-hydroxy-3-(oxan-4-yl)isoquinolin-1-yl]benzoate is sourced from PubChem (CID 166773188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).