C18H15F6N5O5S — CID 166773278
[6-amino-7-carbamoyl-5-(3-methoxy-2,6-dimethylphenyl)-3-(trifluoromethyl)pyrrolo[2,3-b]pyrazin-2-yl] trifluoromethanesulfonate (PubChem CID 166773278) has the molecular formula C18H15F6N5O5S and a molecular weight of 527.40 g/mol. Its IUPAC name is [6-amino-7-carbamoyl-5-(3-methoxy-2,6-dimethylphenyl)-3-(trifluoromethyl)pyrrolo[2,3-b]pyrazin-2-yl] trifluoromethanesulfonate.
| Compound Name | [6-amino-7-carbamoyl-5-(3-methoxy-2,6-dimethylphenyl)-3-(trifluoromethyl)pyrrolo[2,3-b]pyrazin-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 166773278 |
| Molecular Formula | C18H15F6N5O5S |
| Molecular Weight | 527.40 g/mol |
| Exact Mass | 527.07 |
| IUPAC Name | [6-amino-7-carbamoyl-5-(3-methoxy-2,6-dimethylphenyl)-3-(trifluoromethyl)pyrrolo[2,3-b]pyrazin-2-yl] trifluoromethanesulfonate |
| SMILES | COc1ccc(C)c(-n2c(N)c(C(N)=O)c3nc(OS(=O)(=O)C(F)(F)F)c(C(F)(F)F)nc32)c1C |
| InChI | InChI=1S/C18H15F6N5O5S/c1-6-4-5-8(33-3)7(2)11(6)29-13(25)9(14(26)30)10-15(29)28-12(17(19,20)21)16(27-10)34-35(31,32)18(22,23)24/h4-5H,25H2,1-3H3,(H2,26,30) |
| InChIKey | QOKDOLPPDGZEHY-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 152.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.40 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|