About 7-bromo-2,6-dimethylnon-7-en-3-amine
7-bromo-2,6-dimethylnon-7-en-3-amine (PubChem CID 166773454) has the molecular formula C11H22BrN
and a molecular weight of 248.21 g/mol. Its IUPAC name is 7-bromo-2,6-dimethylnon-7-en-3-amine.
Molecular Properties
| Compound Name | 7-bromo-2,6-dimethylnon-7-en-3-amine |
| PubChem CID | 166773454 |
| Molecular Formula | C11H22BrN |
| Molecular Weight | 248.21 g/mol |
| Exact Mass | 247.09 |
| IUPAC Name | 7-bromo-2,6-dimethylnon-7-en-3-amine |
| SMILES | CC=C(Br)C(C)CCC(N)C(C)C |
| InChI | InChI=1S/C11H22BrN/c1-5-10(12)9(4)6-7-11(13)8(2)3/h5,8-9,11H,6-7,13H2,1-4H3 |
| InChIKey | NAVVUGAFSJCKDA-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.21 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7-bromo-2,6-dimethylnon-7-en-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-2,6-dimethylnon-7-en-3-amine?
The IUPAC name of 7-bromo-2,6-dimethylnon-7-en-3-amine (CID 166773454) is 7-bromo-2,6-dimethylnon-7-en-3-amine.
What is the SMILES notation for 7-bromo-2,6-dimethylnon-7-en-3-amine?
The canonical SMILES for 7-bromo-2,6-dimethylnon-7-en-3-amine is CC=C(Br)C(C)CCC(N)C(C)C.
What is the InChIKey of 7-bromo-2,6-dimethylnon-7-en-3-amine?
The InChIKey is NAVVUGAFSJCKDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22BrN/c1-5-10(12)9(4)6-7-11(13)8(2)3/h5,8-9,11H,6-7,13H2,1-4H3.
What are the key properties of 7-bromo-2,6-dimethylnon-7-en-3-amine?
7-bromo-2,6-dimethylnon-7-en-3-amine has a molecular weight of 248.21 g/mol, XLogP of 3.68, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-2,6-dimethylnon-7-en-3-amine is sourced from PubChem (CID 166773454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).