C18H26N10 — CID 166773713
3-[(1S,5R)-3-[[4-hydrazinyl-6-[(5-methyl-1H-pyrazol-3-yl)amino]pyrimidin-2-yl]amino]-8-azabicyclo[3.2.1]octan-8-yl]propanenitrile (PubChem CID 166773713) has the molecular formula C18H26N10 and a molecular weight of 382.48 g/mol. Its IUPAC name is 3-[(1S,5R)-3-[[4-hydrazinyl-6-[(5-methyl-1H-pyrazol-3-yl)amino]pyrimidin-2-yl]amino]-8-azabicyclo[3.2.1]octan-8-yl]propanenitrile.
| Compound Name | 3-[(1S,5R)-3-[[4-hydrazinyl-6-[(5-methyl-1H-pyrazol-3-yl)amino]pyrimidin-2-yl]amino]-8-azabicyclo[3.2.1]octan-8-yl]propanenitrile |
|---|---|
| PubChem CID | 166773713 |
| Molecular Formula | C18H26N10 |
| Molecular Weight | 382.48 g/mol |
| Exact Mass | 382.23 |
| IUPAC Name | 3-[(1S,5R)-3-[[4-hydrazinyl-6-[(5-methyl-1H-pyrazol-3-yl)amino]pyrimidin-2-yl]amino]-8-azabicyclo[3.2.1]octan-8-yl]propanenitrile |
| SMILES | Cc1cc(Nc2cc(NN)nc(NC3C[C@H]4CC[C@@H](C3)N4CCC#N)n2)n[nH]1 |
| InChI | InChI=1S/C18H26N10/c1-11-7-17(27-26-11)22-15-10-16(25-20)24-18(23-15)21-12-8-13-3-4-14(9-12)28(13)6-2-5-19/h7,10,12-14H,2-4,6,8-9,20H2,1H3,(H4,21,22,23,24,25,26,27)/t12?,13-,14+ |
| InChIKey | GBTWKCZDGUACTB-AGUYFDCRSA-N |
| XLogP | 1.86 |
| TPSA | 143.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.48 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|