About (3Z,5Z)-4-[amino(ethenyl)amino]-2-methylhepta-3,5-dien-3-amine
(3Z,5Z)-4-[amino(ethenyl)amino]-2-methylhepta-3,5-dien-3-amine (PubChem CID 166773733) has the molecular formula C10H19N3
and a molecular weight of 181.28 g/mol. Its IUPAC name is (3Z,5Z)-4-[amino(ethenyl)amino]-2-methylhepta-3,5-dien-3-amine.
Molecular Properties
| Compound Name | (3Z,5Z)-4-[amino(ethenyl)amino]-2-methylhepta-3,5-dien-3-amine |
| PubChem CID | 166773733 |
| Molecular Formula | C10H19N3 |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.16 |
| IUPAC Name | (3Z,5Z)-4-[amino(ethenyl)amino]-2-methylhepta-3,5-dien-3-amine |
| SMILES | C=CN(N)C(/C=C\C)=C(\N)C(C)C |
| InChI | InChI=1S/C10H19N3/c1-5-7-9(13(12)6-2)10(11)8(3)4/h5-8H,2,11-12H2,1,3-4H3/b7-5-,10-9- |
| InChIKey | BGZQTLCOMSFZEU-XGOROQTFSA-N |
| XLogP | 1.71 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3Z,5Z)-4-[amino(ethenyl)amino]-2-methylhepta-3,5-dien-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z,5Z)-4-[amino(ethenyl)amino]-2-methylhepta-3,5-dien-3-amine?
The IUPAC name of (3Z,5Z)-4-[amino(ethenyl)amino]-2-methylhepta-3,5-dien-3-amine (CID 166773733) is (3Z,5Z)-4-[amino(ethenyl)amino]-2-methylhepta-3,5-dien-3-amine.
What is the SMILES notation for (3Z,5Z)-4-[amino(ethenyl)amino]-2-methylhepta-3,5-dien-3-amine?
The canonical SMILES for (3Z,5Z)-4-[amino(ethenyl)amino]-2-methylhepta-3,5-dien-3-amine is C=CN(N)C(/C=C\C)=C(\N)C(C)C.
What is the InChIKey of (3Z,5Z)-4-[amino(ethenyl)amino]-2-methylhepta-3,5-dien-3-amine?
The InChIKey is BGZQTLCOMSFZEU-XGOROQTFSA-N. The full InChI is InChI=1S/C10H19N3/c1-5-7-9(13(12)6-2)10(11)8(3)4/h5-8H,2,11-12H2,1,3-4H3/b7-5-,10-9-.
What are the key properties of (3Z,5Z)-4-[amino(ethenyl)amino]-2-methylhepta-3,5-dien-3-amine?
(3Z,5Z)-4-[amino(ethenyl)amino]-2-methylhepta-3,5-dien-3-amine has a molecular weight of 181.28 g/mol, XLogP of 1.71, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z,5Z)-4-[amino(ethenyl)amino]-2-methylhepta-3,5-dien-3-amine is sourced from PubChem (CID 166773733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).