About 2,4-dimethyl-3a,7a-dihydro-1H-benzimidazole
2,4-dimethyl-3a,7a-dihydro-1H-benzimidazole (PubChem CID 166774077) has the molecular formula C9H12N2
and a molecular weight of 148.21 g/mol. Its IUPAC name is 2,4-dimethyl-3a,7a-dihydro-1H-benzimidazole.
Molecular Properties
| Compound Name | 2,4-dimethyl-3a,7a-dihydro-1H-benzimidazole |
| PubChem CID | 166774077 |
| Molecular Formula | C9H12N2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | 2,4-dimethyl-3a,7a-dihydro-1H-benzimidazole |
| SMILES | CC1=CC=CC2NC(C)=NC12 |
| InChI | InChI=1S/C9H12N2/c1-6-4-3-5-8-9(6)11-7(2)10-8/h3-5,8-9H,1-2H3,(H,10,11) |
| InChIKey | WPUWWZMKJNLKGP-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,4-dimethyl-3a,7a-dihydro-1H-benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethyl-3a,7a-dihydro-1H-benzimidazole?
The IUPAC name of 2,4-dimethyl-3a,7a-dihydro-1H-benzimidazole (CID 166774077) is 2,4-dimethyl-3a,7a-dihydro-1H-benzimidazole.
What is the SMILES notation for 2,4-dimethyl-3a,7a-dihydro-1H-benzimidazole?
The canonical SMILES for 2,4-dimethyl-3a,7a-dihydro-1H-benzimidazole is CC1=CC=CC2NC(C)=NC12.
What is the InChIKey of 2,4-dimethyl-3a,7a-dihydro-1H-benzimidazole?
The InChIKey is WPUWWZMKJNLKGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2/c1-6-4-3-5-8-9(6)11-7(2)10-8/h3-5,8-9H,1-2H3,(H,10,11).
What are the key properties of 2,4-dimethyl-3a,7a-dihydro-1H-benzimidazole?
2,4-dimethyl-3a,7a-dihydro-1H-benzimidazole has a molecular weight of 148.21 g/mol, XLogP of 1.26, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethyl-3a,7a-dihydro-1H-benzimidazole is sourced from PubChem (CID 166774077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).