C27H23FN4O — CID 166774202
N-[(2E,4Z)-6-[(4-fluorophenyl)methyl]hepta-2,4,6-trien-3-yl]-5-pyridin-3-yl-1H-indazole-3-carboxamide (PubChem CID 166774202) has the molecular formula C27H23FN4O and a molecular weight of 438.51 g/mol. Its IUPAC name is N-[(2E,4Z)-6-[(4-fluorophenyl)methyl]hepta-2,4,6-trien-3-yl]-5-pyridin-3-yl-1H-indazole-3-carboxamide.
| Compound Name | N-[(2E,4Z)-6-[(4-fluorophenyl)methyl]hepta-2,4,6-trien-3-yl]-5-pyridin-3-yl-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 166774202 |
| Molecular Formula | C27H23FN4O |
| Molecular Weight | 438.51 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | N-[(2E,4Z)-6-[(4-fluorophenyl)methyl]hepta-2,4,6-trien-3-yl]-5-pyridin-3-yl-1H-indazole-3-carboxamide |
| SMILES | C=C(/C=C\C(=C/C)NC(=O)c1n[nH]c2ccc(-c3cccnc3)cc12)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C27H23FN4O/c1-3-23(12-6-18(2)15-19-7-10-22(28)11-8-19)30-27(33)26-24-16-20(9-13-25(24)31-32-26)21-5-4-14-29-17-21/h3-14,16-17H,2,15H2,1H3,(H,30,33)(H,31,32)/b12-6-,23-3+ |
| InChIKey | DDUGBIRHPBPFAM-CIVJFRGLSA-N |
| XLogP | 5.75 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.51 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|