C31H29N5O3 — CID 166774329
2-[2-(methylamino)-5-(5-phenoxy-3-pyridinyl)phenyl]-N-[6-(pyrrolidine-1-carbonyl)-3-pyridinyl]prop-2-enamide (PubChem CID 166774329) has the molecular formula C31H29N5O3 and a molecular weight of 519.61 g/mol. Its IUPAC name is 2-[2-(methylamino)-5-(5-phenoxy-3-pyridinyl)phenyl]-N-[6-(pyrrolidine-1-carbonyl)-3-pyridinyl]prop-2-enamide.
| Compound Name | 2-[2-(methylamino)-5-(5-phenoxy-3-pyridinyl)phenyl]-N-[6-(pyrrolidine-1-carbonyl)-3-pyridinyl]prop-2-enamide |
|---|---|
| PubChem CID | 166774329 |
| Molecular Formula | C31H29N5O3 |
| Molecular Weight | 519.61 g/mol |
| Exact Mass | 519.23 |
| IUPAC Name | 2-[2-(methylamino)-5-(5-phenoxy-3-pyridinyl)phenyl]-N-[6-(pyrrolidine-1-carbonyl)-3-pyridinyl]prop-2-enamide |
| SMILES | C=C(C(=O)Nc1ccc(C(=O)N2CCCC2)nc1)c1cc(-c2cncc(Oc3ccccc3)c2)ccc1NC |
| InChI | InChI=1S/C31H29N5O3/c1-21(30(37)35-24-11-13-29(34-19-24)31(38)36-14-6-7-15-36)27-17-22(10-12-28(27)32-2)23-16-26(20-33-18-23)39-25-8-4-3-5-9-25/h3-5,8-13,16-20,32H,1,6-7,14-15H2,2H3,(H,35,37) |
| InChIKey | HNCQSKBVRQWHLB-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.61 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|