About N-[(3E)-hexa-3,5-dien-3-yl]oxan-2-amine
N-[(3E)-hexa-3,5-dien-3-yl]oxan-2-amine (PubChem CID 166774370) has the molecular formula C11H19NO
and a molecular weight of 181.28 g/mol. Its IUPAC name is N-[(3E)-hexa-3,5-dien-3-yl]oxan-2-amine.
Molecular Properties
| Compound Name | N-[(3E)-hexa-3,5-dien-3-yl]oxan-2-amine |
| PubChem CID | 166774370 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | N-[(3E)-hexa-3,5-dien-3-yl]oxan-2-amine |
| SMILES | C=C/C=C(\CC)NC1CCCCO1 |
| InChI | InChI=1S/C11H19NO/c1-3-7-10(4-2)12-11-8-5-6-9-13-11/h3,7,11-12H,1,4-6,8-9H2,2H3/b10-7+ |
| InChIKey | VTGCCWNRLOVTQA-JXMROGBWSA-N |
| XLogP | 2.58 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(3E)-hexa-3,5-dien-3-yl]oxan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3E)-hexa-3,5-dien-3-yl]oxan-2-amine?
The IUPAC name of N-[(3E)-hexa-3,5-dien-3-yl]oxan-2-amine (CID 166774370) is N-[(3E)-hexa-3,5-dien-3-yl]oxan-2-amine.
What is the SMILES notation for N-[(3E)-hexa-3,5-dien-3-yl]oxan-2-amine?
The canonical SMILES for N-[(3E)-hexa-3,5-dien-3-yl]oxan-2-amine is C=C/C=C(\CC)NC1CCCCO1.
What is the InChIKey of N-[(3E)-hexa-3,5-dien-3-yl]oxan-2-amine?
The InChIKey is VTGCCWNRLOVTQA-JXMROGBWSA-N. The full InChI is InChI=1S/C11H19NO/c1-3-7-10(4-2)12-11-8-5-6-9-13-11/h3,7,11-12H,1,4-6,8-9H2,2H3/b10-7+.
What are the key properties of N-[(3E)-hexa-3,5-dien-3-yl]oxan-2-amine?
N-[(3E)-hexa-3,5-dien-3-yl]oxan-2-amine has a molecular weight of 181.28 g/mol, XLogP of 2.58, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3E)-hexa-3,5-dien-3-yl]oxan-2-amine is sourced from PubChem (CID 166774370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).