About 2,5-dimethyl-1-propan-2-yl-3aH-pyrazolo[1,5-a]pyridine
2,5-dimethyl-1-propan-2-yl-3aH-pyrazolo[1,5-a]pyridine (PubChem CID 166774723) has the molecular formula C12H18N2
and a molecular weight of 190.29 g/mol. Its IUPAC name is 2,5-dimethyl-1-propan-2-yl-3aH-pyrazolo[1,5-a]pyridine.
Molecular Properties
| Compound Name | 2,5-dimethyl-1-propan-2-yl-3aH-pyrazolo[1,5-a]pyridine |
| PubChem CID | 166774723 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | 2,5-dimethyl-1-propan-2-yl-3aH-pyrazolo[1,5-a]pyridine |
| SMILES | CC1=CC2C=C(C)N(C(C)C)N2C=C1 |
| InChI | InChI=1S/C12H18N2/c1-9(2)14-11(4)8-12-7-10(3)5-6-13(12)14/h5-9,12H,1-4H3 |
| InChIKey | UZZMMJNIRCWOBI-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,5-dimethyl-1-propan-2-yl-3aH-pyrazolo[1,5-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dimethyl-1-propan-2-yl-3aH-pyrazolo[1,5-a]pyridine?
The IUPAC name of 2,5-dimethyl-1-propan-2-yl-3aH-pyrazolo[1,5-a]pyridine (CID 166774723) is 2,5-dimethyl-1-propan-2-yl-3aH-pyrazolo[1,5-a]pyridine.
What is the SMILES notation for 2,5-dimethyl-1-propan-2-yl-3aH-pyrazolo[1,5-a]pyridine?
The canonical SMILES for 2,5-dimethyl-1-propan-2-yl-3aH-pyrazolo[1,5-a]pyridine is CC1=CC2C=C(C)N(C(C)C)N2C=C1.
What is the InChIKey of 2,5-dimethyl-1-propan-2-yl-3aH-pyrazolo[1,5-a]pyridine?
The InChIKey is UZZMMJNIRCWOBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2/c1-9(2)14-11(4)8-12-7-10(3)5-6-13(12)14/h5-9,12H,1-4H3.
What are the key properties of 2,5-dimethyl-1-propan-2-yl-3aH-pyrazolo[1,5-a]pyridine?
2,5-dimethyl-1-propan-2-yl-3aH-pyrazolo[1,5-a]pyridine has a molecular weight of 190.29 g/mol, XLogP of 2.67, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dimethyl-1-propan-2-yl-3aH-pyrazolo[1,5-a]pyridine is sourced from PubChem (CID 166774723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).