About 5-propan-2-yl-1,4-dihydropyridine-2-carbonitrile
5-propan-2-yl-1,4-dihydropyridine-2-carbonitrile (PubChem CID 166774800) has the molecular formula C9H12N2
and a molecular weight of 148.21 g/mol. Its IUPAC name is 5-propan-2-yl-1,4-dihydropyridine-2-carbonitrile.
Molecular Properties
| Compound Name | 5-propan-2-yl-1,4-dihydropyridine-2-carbonitrile |
| PubChem CID | 166774800 |
| Molecular Formula | C9H12N2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | 5-propan-2-yl-1,4-dihydropyridine-2-carbonitrile |
| SMILES | CC(C)C1=CNC(C#N)=CC1 |
| InChI | InChI=1S/C9H12N2/c1-7(2)8-3-4-9(5-10)11-6-8/h4,6-7,11H,3H2,1-2H3 |
| InChIKey | RLNCJEIFGNFWKP-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-propan-2-yl-1,4-dihydropyridine-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-propan-2-yl-1,4-dihydropyridine-2-carbonitrile?
The IUPAC name of 5-propan-2-yl-1,4-dihydropyridine-2-carbonitrile (CID 166774800) is 5-propan-2-yl-1,4-dihydropyridine-2-carbonitrile.
What is the SMILES notation for 5-propan-2-yl-1,4-dihydropyridine-2-carbonitrile?
The canonical SMILES for 5-propan-2-yl-1,4-dihydropyridine-2-carbonitrile is CC(C)C1=CNC(C#N)=CC1.
What is the InChIKey of 5-propan-2-yl-1,4-dihydropyridine-2-carbonitrile?
The InChIKey is RLNCJEIFGNFWKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2/c1-7(2)8-3-4-9(5-10)11-6-8/h4,6-7,11H,3H2,1-2H3.
What are the key properties of 5-propan-2-yl-1,4-dihydropyridine-2-carbonitrile?
5-propan-2-yl-1,4-dihydropyridine-2-carbonitrile has a molecular weight of 148.21 g/mol, XLogP of 1.93, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-propan-2-yl-1,4-dihydropyridine-2-carbonitrile is sourced from PubChem (CID 166774800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).