About 3-[(3E)-5-fluorohexa-3,5-dien-3-yl]-1,2-oxazole
3-[(3E)-5-fluorohexa-3,5-dien-3-yl]-1,2-oxazole (PubChem CID 166774866) has the molecular formula C9H10FNO
and a molecular weight of 167.18 g/mol. Its IUPAC name is 3-[(3E)-5-fluorohexa-3,5-dien-3-yl]-1,2-oxazole.
Molecular Properties
| Compound Name | 3-[(3E)-5-fluorohexa-3,5-dien-3-yl]-1,2-oxazole |
| PubChem CID | 166774866 |
| Molecular Formula | C9H10FNO |
| Molecular Weight | 167.18 g/mol |
| Exact Mass | 167.07 |
| IUPAC Name | 3-[(3E)-5-fluorohexa-3,5-dien-3-yl]-1,2-oxazole |
| SMILES | C=C(F)/C=C(\CC)c1ccon1 |
| InChI | InChI=1S/C9H10FNO/c1-3-8(6-7(2)10)9-4-5-12-11-9/h4-6H,2-3H2,1H3/b8-6+ |
| InChIKey | YZNYPQGZRMAXTN-SOFGYWHQSA-N |
| XLogP | 2.95 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.18 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 3-[(3E)-5-fluorohexa-3,5-dien-3-yl]-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3E)-5-fluorohexa-3,5-dien-3-yl]-1,2-oxazole?
The IUPAC name of 3-[(3E)-5-fluorohexa-3,5-dien-3-yl]-1,2-oxazole (CID 166774866) is 3-[(3E)-5-fluorohexa-3,5-dien-3-yl]-1,2-oxazole.
What is the SMILES notation for 3-[(3E)-5-fluorohexa-3,5-dien-3-yl]-1,2-oxazole?
The canonical SMILES for 3-[(3E)-5-fluorohexa-3,5-dien-3-yl]-1,2-oxazole is C=C(F)/C=C(\CC)c1ccon1.
What is the InChIKey of 3-[(3E)-5-fluorohexa-3,5-dien-3-yl]-1,2-oxazole?
The InChIKey is YZNYPQGZRMAXTN-SOFGYWHQSA-N. The full InChI is InChI=1S/C9H10FNO/c1-3-8(6-7(2)10)9-4-5-12-11-9/h4-6H,2-3H2,1H3/b8-6+.
What are the key properties of 3-[(3E)-5-fluorohexa-3,5-dien-3-yl]-1,2-oxazole?
3-[(3E)-5-fluorohexa-3,5-dien-3-yl]-1,2-oxazole has a molecular weight of 167.18 g/mol, XLogP of 2.95, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3E)-5-fluorohexa-3,5-dien-3-yl]-1,2-oxazole is sourced from PubChem (CID 166774866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).