About 6-(4-chlorobut-1-en-2-yl)-3-methylcyclohexa-2,4-dien-1-imine
6-(4-chlorobut-1-en-2-yl)-3-methylcyclohexa-2,4-dien-1-imine (PubChem CID 166774869) has the molecular formula C11H14ClN
and a molecular weight of 195.69 g/mol. Its IUPAC name is 6-(4-chlorobut-1-en-2-yl)-3-methylcyclohexa-2,4-dien-1-imine.
Molecular Properties
| Compound Name | 6-(4-chlorobut-1-en-2-yl)-3-methylcyclohexa-2,4-dien-1-imine |
| PubChem CID | 166774869 |
| Molecular Formula | C11H14ClN |
| Molecular Weight | 195.69 g/mol |
| Exact Mass | 195.08 |
| IUPAC Name | 6-(4-chlorobut-1-en-2-yl)-3-methylcyclohexa-2,4-dien-1-imine |
| SMILES | [H]/N=C1\C=C(C)C=CC1C(=C)CCCl |
| InChI | InChI=1S/C11H14ClN/c1-8-3-4-10(11(13)7-8)9(2)5-6-12/h3-4,7,10,13H,2,5-6H2,1H3/b13-11+ |
| InChIKey | KTHOVLHNNJTORS-ACCUITESSA-N |
| XLogP | 3.32 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.69 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-(4-chlorobut-1-en-2-yl)-3-methylcyclohexa-2,4-dien-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4-chlorobut-1-en-2-yl)-3-methylcyclohexa-2,4-dien-1-imine?
The IUPAC name of 6-(4-chlorobut-1-en-2-yl)-3-methylcyclohexa-2,4-dien-1-imine (CID 166774869) is 6-(4-chlorobut-1-en-2-yl)-3-methylcyclohexa-2,4-dien-1-imine.
What is the SMILES notation for 6-(4-chlorobut-1-en-2-yl)-3-methylcyclohexa-2,4-dien-1-imine?
The canonical SMILES for 6-(4-chlorobut-1-en-2-yl)-3-methylcyclohexa-2,4-dien-1-imine is [H]/N=C1\C=C(C)C=CC1C(=C)CCCl.
What is the InChIKey of 6-(4-chlorobut-1-en-2-yl)-3-methylcyclohexa-2,4-dien-1-imine?
The InChIKey is KTHOVLHNNJTORS-ACCUITESSA-N. The full InChI is InChI=1S/C11H14ClN/c1-8-3-4-10(11(13)7-8)9(2)5-6-12/h3-4,7,10,13H,2,5-6H2,1H3/b13-11+.
What are the key properties of 6-(4-chlorobut-1-en-2-yl)-3-methylcyclohexa-2,4-dien-1-imine?
6-(4-chlorobut-1-en-2-yl)-3-methylcyclohexa-2,4-dien-1-imine has a molecular weight of 195.69 g/mol, XLogP of 3.32, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4-chlorobut-1-en-2-yl)-3-methylcyclohexa-2,4-dien-1-imine is sourced from PubChem (CID 166774869), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).