C21H21FIN3O3 — CID 166774980
3-fluoro-5-iodo-N-methyl-4-[6-methyl-3-[[(2S)-morpholin-2-yl]methyl]furo[2,3-b]pyridin-2-yl]benzamide (PubChem CID 166774980) has the molecular formula C21H21FIN3O3 and a molecular weight of 509.32 g/mol. Its IUPAC name is 3-fluoro-5-iodo-N-methyl-4-[6-methyl-3-[[(2S)-morpholin-2-yl]methyl]furo[2,3-b]pyridin-2-yl]benzamide.
| Compound Name | 3-fluoro-5-iodo-N-methyl-4-[6-methyl-3-[[(2S)-morpholin-2-yl]methyl]furo[2,3-b]pyridin-2-yl]benzamide |
|---|---|
| PubChem CID | 166774980 |
| Molecular Formula | C21H21FIN3O3 |
| Molecular Weight | 509.32 g/mol |
| Exact Mass | 509.06 |
| IUPAC Name | 3-fluoro-5-iodo-N-methyl-4-[6-methyl-3-[[(2S)-morpholin-2-yl]methyl]furo[2,3-b]pyridin-2-yl]benzamide |
| SMILES | CNC(=O)c1cc(F)c(-c2oc3nc(C)ccc3c2C[C@H]2CNCCO2)c(I)c1 |
| InChI | InChI=1S/C21H21FIN3O3/c1-11-3-4-14-15(9-13-10-25-5-6-28-13)19(29-21(14)26-11)18-16(22)7-12(8-17(18)23)20(27)24-2/h3-4,7-8,13,25H,5-6,9-10H2,1-2H3,(H,24,27)/t13-/m0/s1 |
| InChIKey | WJHLUXMQSJNNQO-ZDUSSCGKSA-N |
| XLogP | 3.44 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.32 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|