About 1-[(2E)-4-fluoropenta-2,4-dien-2-yl]piperazin-2-one
1-[(2E)-4-fluoropenta-2,4-dien-2-yl]piperazin-2-one (PubChem CID 166774991) has the molecular formula C9H13FN2O
and a molecular weight of 184.21 g/mol. Its IUPAC name is 1-[(2E)-4-fluoropenta-2,4-dien-2-yl]piperazin-2-one.
Molecular Properties
| Compound Name | 1-[(2E)-4-fluoropenta-2,4-dien-2-yl]piperazin-2-one |
| PubChem CID | 166774991 |
| Molecular Formula | C9H13FN2O |
| Molecular Weight | 184.21 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | 1-[(2E)-4-fluoropenta-2,4-dien-2-yl]piperazin-2-one |
| SMILES | C=C(F)/C=C(\C)N1CCNCC1=O |
| InChI | InChI=1S/C9H13FN2O/c1-7(10)5-8(2)12-4-3-11-6-9(12)13/h5,11H,1,3-4,6H2,2H3/b8-5+ |
| InChIKey | MMQFPMKYEICRFQ-VMPITWQZSA-N |
| XLogP | 0.81 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.21 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(2E)-4-fluoropenta-2,4-dien-2-yl]piperazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2E)-4-fluoropenta-2,4-dien-2-yl]piperazin-2-one?
The IUPAC name of 1-[(2E)-4-fluoropenta-2,4-dien-2-yl]piperazin-2-one (CID 166774991) is 1-[(2E)-4-fluoropenta-2,4-dien-2-yl]piperazin-2-one.
What is the SMILES notation for 1-[(2E)-4-fluoropenta-2,4-dien-2-yl]piperazin-2-one?
The canonical SMILES for 1-[(2E)-4-fluoropenta-2,4-dien-2-yl]piperazin-2-one is C=C(F)/C=C(\C)N1CCNCC1=O.
What is the InChIKey of 1-[(2E)-4-fluoropenta-2,4-dien-2-yl]piperazin-2-one?
The InChIKey is MMQFPMKYEICRFQ-VMPITWQZSA-N. The full InChI is InChI=1S/C9H13FN2O/c1-7(10)5-8(2)12-4-3-11-6-9(12)13/h5,11H,1,3-4,6H2,2H3/b8-5+.
What are the key properties of 1-[(2E)-4-fluoropenta-2,4-dien-2-yl]piperazin-2-one?
1-[(2E)-4-fluoropenta-2,4-dien-2-yl]piperazin-2-one has a molecular weight of 184.21 g/mol, XLogP of 0.81, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2E)-4-fluoropenta-2,4-dien-2-yl]piperazin-2-one is sourced from PubChem (CID 166774991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).