C14H14N2O4 — CID 166775737
(3R)-6-amino-3'-(2-oxopropyl)spiro[1,2-dihydroindene-3,5'-1,3-oxazolidine]-2',4'-dione (PubChem CID 166775737) has the molecular formula C14H14N2O4 and a molecular weight of 274.28 g/mol. Its IUPAC name is (3R)-6-amino-3'-(2-oxopropyl)spiro[1,2-dihydroindene-3,5'-1,3-oxazolidine]-2',4'-dione.
| Compound Name | (3R)-6-amino-3'-(2-oxopropyl)spiro[1,2-dihydroindene-3,5'-1,3-oxazolidine]-2',4'-dione |
|---|---|
| PubChem CID | 166775737 |
| Molecular Formula | C14H14N2O4 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | (3R)-6-amino-3'-(2-oxopropyl)spiro[1,2-dihydroindene-3,5'-1,3-oxazolidine]-2',4'-dione |
| SMILES | CC(=O)CN1C(=O)O[C@@]2(CCc3cc(N)ccc32)C1=O |
| InChI | InChI=1S/C14H14N2O4/c1-8(17)7-16-12(18)14(20-13(16)19)5-4-9-6-10(15)2-3-11(9)14/h2-3,6H,4-5,7,15H2,1H3/t14-/m1/s1 |
| InChIKey | LHVZMVRQOUHYOX-CQSZACIVSA-N |
| XLogP | 0.98 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|