C19H20FNO2 — CID 166775760
(3R,7aR)-7a-(4-fluorophenyl)-5-methyl-3-phenyl-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]oxazol-5-ol (PubChem CID 166775760) has the molecular formula C19H20FNO2 and a molecular weight of 313.37 g/mol. Its IUPAC name is (3R,7aR)-7a-(4-fluorophenyl)-5-methyl-3-phenyl-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]oxazol-5-ol.
| Compound Name | (3R,7aR)-7a-(4-fluorophenyl)-5-methyl-3-phenyl-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]oxazol-5-ol |
|---|---|
| PubChem CID | 166775760 |
| Molecular Formula | C19H20FNO2 |
| Molecular Weight | 313.37 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | (3R,7aR)-7a-(4-fluorophenyl)-5-methyl-3-phenyl-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]oxazol-5-ol |
| SMILES | CC1(O)CC[C@]2(c3ccc(F)cc3)OC[C@@H](c3ccccc3)N12 |
| InChI | InChI=1S/C19H20FNO2/c1-18(22)11-12-19(15-7-9-16(20)10-8-15)21(18)17(13-23-19)14-5-3-2-4-6-14/h2-10,17,22H,11-13H2,1H3/t17-,18?,19+/m0/s1 |
| InChIKey | GJUWRFGMVSGVFK-LJJQOFDWSA-N |
| XLogP | 3.55 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.37 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |