C18H23F2NO2 — CID 166775870
(3R,7aR)-7a-(4,4-difluorocyclohexyl)-3-phenyl-3,5,6,7-tetrahydro-2H-pyrrolo[2,1-b][1,3]oxazol-5-ol (PubChem CID 166775870) has the molecular formula C18H23F2NO2 and a molecular weight of 323.38 g/mol. Its IUPAC name is (3R,7aR)-7a-(4,4-difluorocyclohexyl)-3-phenyl-3,5,6,7-tetrahydro-2H-pyrrolo[2,1-b][1,3]oxazol-5-ol.
| Compound Name | (3R,7aR)-7a-(4,4-difluorocyclohexyl)-3-phenyl-3,5,6,7-tetrahydro-2H-pyrrolo[2,1-b][1,3]oxazol-5-ol |
|---|---|
| PubChem CID | 166775870 |
| Molecular Formula | C18H23F2NO2 |
| Molecular Weight | 323.38 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | (3R,7aR)-7a-(4,4-difluorocyclohexyl)-3-phenyl-3,5,6,7-tetrahydro-2H-pyrrolo[2,1-b][1,3]oxazol-5-ol |
| SMILES | OC1CC[C@]2(C3CCC(F)(F)CC3)OC[C@@H](c3ccccc3)N12 |
| InChI | InChI=1S/C18H23F2NO2/c19-17(20)9-6-14(7-10-17)18-11-8-16(22)21(18)15(12-23-18)13-4-2-1-3-5-13/h1-5,14-16,22H,6-12H2/t15-,16?,18+/m0/s1 |
| InChIKey | NIVIILAMOAMYRO-NANQTSIFSA-N |
| XLogP | 3.69 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.38 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |