C24H25F4N5O — CID 166776115
2-[1-[6-[[4-(2-aminoethyl)phenyl]methylamino]-5-fluoropyrimidin-4-yl]pyrrolidin-2-yl]-5-(trifluoromethyl)phenol (PubChem CID 166776115) has the molecular formula C24H25F4N5O and a molecular weight of 475.49 g/mol. Its IUPAC name is 2-[1-[6-[[4-(2-aminoethyl)phenyl]methylamino]-5-fluoropyrimidin-4-yl]pyrrolidin-2-yl]-5-(trifluoromethyl)phenol.
| Compound Name | 2-[1-[6-[[4-(2-aminoethyl)phenyl]methylamino]-5-fluoropyrimidin-4-yl]pyrrolidin-2-yl]-5-(trifluoromethyl)phenol |
|---|---|
| PubChem CID | 166776115 |
| Molecular Formula | C24H25F4N5O |
| Molecular Weight | 475.49 g/mol |
| Exact Mass | 475.20 |
| IUPAC Name | 2-[1-[6-[[4-(2-aminoethyl)phenyl]methylamino]-5-fluoropyrimidin-4-yl]pyrrolidin-2-yl]-5-(trifluoromethyl)phenol |
| SMILES | NCCc1ccc(CNc2ncnc(N3CCCC3c3ccc(C(F)(F)F)cc3O)c2F)cc1 |
| InChI | InChI=1S/C24H25F4N5O/c25-21-22(30-13-16-5-3-15(4-6-16)9-10-29)31-14-32-23(21)33-11-1-2-19(33)18-8-7-17(12-20(18)34)24(26,27)28/h3-8,12,14,19,34H,1-2,9-11,13,29H2,(H,30,31,32) |
| InChIKey | XLZRIJSOWLTYOY-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.49 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|