C16H20N4 — CID 166776619
(1Z,3Z)-1-(2-methyl-4-pyrazol-1-ylphenyl)hexa-1,3-diene-1,4-diamine (PubChem CID 166776619) has the molecular formula C16H20N4 and a molecular weight of 268.36 g/mol. Its IUPAC name is (1Z,3Z)-1-(2-methyl-4-pyrazol-1-ylphenyl)hexa-1,3-diene-1,4-diamine.
| Compound Name | (1Z,3Z)-1-(2-methyl-4-pyrazol-1-ylphenyl)hexa-1,3-diene-1,4-diamine |
|---|---|
| PubChem CID | 166776619 |
| Molecular Formula | C16H20N4 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | (1Z,3Z)-1-(2-methyl-4-pyrazol-1-ylphenyl)hexa-1,3-diene-1,4-diamine |
| SMILES | CC/C(N)=C/C=C(\N)c1ccc(-n2cccn2)cc1C |
| InChI | InChI=1S/C16H20N4/c1-3-13(17)5-8-16(18)15-7-6-14(11-12(15)2)20-10-4-9-19-20/h4-11H,3,17-18H2,1-2H3/b13-5-,16-8- |
| InChIKey | ITTAVMNRPOULOQ-ZJLQUHJZSA-N |
| XLogP | 2.73 |
| TPSA | 69.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|