C9H16N2 — CID 166776790
3,5-dimethyl-1,2,4,5,6,7-hexahydropyrazolo[1,5-a]pyridine (PubChem CID 166776790) has the molecular formula C9H16N2 and a molecular weight of 152.24 g/mol. Its IUPAC name is 3,5-dimethyl-1,2,4,5,6,7-hexahydropyrazolo[1,5-a]pyridine.
| Compound Name | 3,5-dimethyl-1,2,4,5,6,7-hexahydropyrazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 166776790 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | 3,5-dimethyl-1,2,4,5,6,7-hexahydropyrazolo[1,5-a]pyridine |
| SMILES | CC1=C2CC(C)CCN2NC1 |
| InChI | InChI=1S/C9H16N2/c1-7-3-4-11-9(5-7)8(2)6-10-11/h7,10H,3-6H2,1-2H3 |
| InChIKey | QVVIQUPHTFZAOG-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |