About 7-bromo-5-propyl-2,1,3-benzothiadiazole-4-carbonitrile
7-bromo-5-propyl-2,1,3-benzothiadiazole-4-carbonitrile (PubChem CID 166776831) has the molecular formula C10H8BrN3S
and a molecular weight of 282.17 g/mol. Its IUPAC name is 7-bromo-5-propyl-2,1,3-benzothiadiazole-4-carbonitrile.
Molecular Properties
| Compound Name | 7-bromo-5-propyl-2,1,3-benzothiadiazole-4-carbonitrile |
| PubChem CID | 166776831 |
| Molecular Formula | C10H8BrN3S |
| Molecular Weight | 282.17 g/mol |
| Exact Mass | 280.96 |
| IUPAC Name | 7-bromo-5-propyl-2,1,3-benzothiadiazole-4-carbonitrile |
| SMILES | CCCc1cc(Br)c2nsnc2c1C#N |
| InChI | InChI=1S/C10H8BrN3S/c1-2-3-6-4-8(11)10-9(7(6)5-12)13-15-14-10/h4H,2-3H2,1H3 |
| InChIKey | OOCMUWPBATZGHE-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 49.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.17 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-bromo-5-propyl-2,1,3-benzothiadiazole-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-5-propyl-2,1,3-benzothiadiazole-4-carbonitrile?
The IUPAC name of 7-bromo-5-propyl-2,1,3-benzothiadiazole-4-carbonitrile (CID 166776831) is 7-bromo-5-propyl-2,1,3-benzothiadiazole-4-carbonitrile.
What is the SMILES notation for 7-bromo-5-propyl-2,1,3-benzothiadiazole-4-carbonitrile?
The canonical SMILES for 7-bromo-5-propyl-2,1,3-benzothiadiazole-4-carbonitrile is CCCc1cc(Br)c2nsnc2c1C#N.
What is the InChIKey of 7-bromo-5-propyl-2,1,3-benzothiadiazole-4-carbonitrile?
The InChIKey is OOCMUWPBATZGHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8BrN3S/c1-2-3-6-4-8(11)10-9(7(6)5-12)13-15-14-10/h4H,2-3H2,1H3.
What are the key properties of 7-bromo-5-propyl-2,1,3-benzothiadiazole-4-carbonitrile?
7-bromo-5-propyl-2,1,3-benzothiadiazole-4-carbonitrile has a molecular weight of 282.17 g/mol, XLogP of 3.28, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-5-propyl-2,1,3-benzothiadiazole-4-carbonitrile is sourced from PubChem (CID 166776831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).