C19H24F3N5O2 — CID 166776913
2-amino-N-[(3R,5S)-1-[8-[amino(hydroxy)methyl]quinolin-5-yl]-5-methylpiperidin-3-yl]-3,3,3-trifluoropropanamide (PubChem CID 166776913) has the molecular formula C19H24F3N5O2 and a molecular weight of 411.43 g/mol. Its IUPAC name is 2-amino-N-[(3R,5S)-1-[8-[amino(hydroxy)methyl]quinolin-5-yl]-5-methylpiperidin-3-yl]-3,3,3-trifluoropropanamide.
| Compound Name | 2-amino-N-[(3R,5S)-1-[8-[amino(hydroxy)methyl]quinolin-5-yl]-5-methylpiperidin-3-yl]-3,3,3-trifluoropropanamide |
|---|---|
| PubChem CID | 166776913 |
| Molecular Formula | C19H24F3N5O2 |
| Molecular Weight | 411.43 g/mol |
| Exact Mass | 411.19 |
| IUPAC Name | 2-amino-N-[(3R,5S)-1-[8-[amino(hydroxy)methyl]quinolin-5-yl]-5-methylpiperidin-3-yl]-3,3,3-trifluoropropanamide |
| SMILES | C[C@H]1C[C@@H](NC(=O)C(N)C(F)(F)F)CN(c2ccc(C(N)O)c3ncccc23)C1 |
| InChI | InChI=1S/C19H24F3N5O2/c1-10-7-11(26-18(29)16(23)19(20,21)22)9-27(8-10)14-5-4-13(17(24)28)15-12(14)3-2-6-25-15/h2-6,10-11,16-17,28H,7-9,23-24H2,1H3,(H,26,29)/t10-,11+,16?,17?/m0/s1 |
| InChIKey | ZNJLMTQQLXELEE-VIKKWZGBSA-N |
| XLogP | 1.40 |
| TPSA | 117.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.43 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|