About 6-methyl-7,8-dihydrodibenzofuran-3-amine
6-methyl-7,8-dihydrodibenzofuran-3-amine (PubChem CID 166777015) has the molecular formula C13H13NO
and a molecular weight of 199.25 g/mol. Its IUPAC name is 6-methyl-7,8-dihydrodibenzofuran-3-amine.
Molecular Properties
| Compound Name | 6-methyl-7,8-dihydrodibenzofuran-3-amine |
| PubChem CID | 166777015 |
| Molecular Formula | C13H13NO |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | 6-methyl-7,8-dihydrodibenzofuran-3-amine |
| SMILES | CC1=c2oc3cc(N)ccc3c2=CCC1 |
| InChI | InChI=1S/C13H13NO/c1-8-3-2-4-11-10-6-5-9(14)7-12(10)15-13(8)11/h4-7H,2-3,14H2,1H3 |
| InChIKey | ZYYRZKGQCDIOPN-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 39.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 6-methyl-7,8-dihydrodibenzofuran-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-7,8-dihydrodibenzofuran-3-amine?
The IUPAC name of 6-methyl-7,8-dihydrodibenzofuran-3-amine (CID 166777015) is 6-methyl-7,8-dihydrodibenzofuran-3-amine.
What is the SMILES notation for 6-methyl-7,8-dihydrodibenzofuran-3-amine?
The canonical SMILES for 6-methyl-7,8-dihydrodibenzofuran-3-amine is CC1=c2oc3cc(N)ccc3c2=CCC1.
What is the InChIKey of 6-methyl-7,8-dihydrodibenzofuran-3-amine?
The InChIKey is ZYYRZKGQCDIOPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NO/c1-8-3-2-4-11-10-6-5-9(14)7-12(10)15-13(8)11/h4-7H,2-3,14H2,1H3.
What are the key properties of 6-methyl-7,8-dihydrodibenzofuran-3-amine?
6-methyl-7,8-dihydrodibenzofuran-3-amine has a molecular weight of 199.25 g/mol, XLogP of 1.76, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-7,8-dihydrodibenzofuran-3-amine is sourced from PubChem (CID 166777015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).