About 2-methoxy-5-(methylsulfanylmethyl)cyclohexa-1,3-diene
2-methoxy-5-(methylsulfanylmethyl)cyclohexa-1,3-diene (PubChem CID 166777671) has the molecular formula C9H14OS
and a molecular weight of 170.28 g/mol. Its IUPAC name is 2-methoxy-5-(methylsulfanylmethyl)cyclohexa-1,3-diene.
Molecular Properties
| Compound Name | 2-methoxy-5-(methylsulfanylmethyl)cyclohexa-1,3-diene |
| PubChem CID | 166777671 |
| Molecular Formula | C9H14OS |
| Molecular Weight | 170.28 g/mol |
| Exact Mass | 170.08 |
| IUPAC Name | 2-methoxy-5-(methylsulfanylmethyl)cyclohexa-1,3-diene |
| SMILES | COC1=CCC(CSC)C=C1 |
| InChI | InChI=1S/C9H14OS/c1-10-9-5-3-8(4-6-9)7-11-2/h3,5-6,8H,4,7H2,1-2H3 |
| InChIKey | YKLZTTVMPJDTHX-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.28 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methoxy-5-(methylsulfanylmethyl)cyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-5-(methylsulfanylmethyl)cyclohexa-1,3-diene?
The IUPAC name of 2-methoxy-5-(methylsulfanylmethyl)cyclohexa-1,3-diene (CID 166777671) is 2-methoxy-5-(methylsulfanylmethyl)cyclohexa-1,3-diene.
What is the SMILES notation for 2-methoxy-5-(methylsulfanylmethyl)cyclohexa-1,3-diene?
The canonical SMILES for 2-methoxy-5-(methylsulfanylmethyl)cyclohexa-1,3-diene is COC1=CCC(CSC)C=C1.
What is the InChIKey of 2-methoxy-5-(methylsulfanylmethyl)cyclohexa-1,3-diene?
The InChIKey is YKLZTTVMPJDTHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14OS/c1-10-9-5-3-8(4-6-9)7-11-2/h3,5-6,8H,4,7H2,1-2H3.
What are the key properties of 2-methoxy-5-(methylsulfanylmethyl)cyclohexa-1,3-diene?
2-methoxy-5-(methylsulfanylmethyl)cyclohexa-1,3-diene has a molecular weight of 170.28 g/mol, XLogP of 2.46, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-5-(methylsulfanylmethyl)cyclohexa-1,3-diene is sourced from PubChem (CID 166777671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).