About N-methyl-4-(methylsulfanylmethyl)cyclohexa-1,5-dien-1-amine
N-methyl-4-(methylsulfanylmethyl)cyclohexa-1,5-dien-1-amine (PubChem CID 166777730) has the molecular formula C9H15NS
and a molecular weight of 169.29 g/mol. Its IUPAC name is N-methyl-4-(methylsulfanylmethyl)cyclohexa-1,5-dien-1-amine.
Molecular Properties
| Compound Name | N-methyl-4-(methylsulfanylmethyl)cyclohexa-1,5-dien-1-amine |
| PubChem CID | 166777730 |
| Molecular Formula | C9H15NS |
| Molecular Weight | 169.29 g/mol |
| Exact Mass | 169.09 |
| IUPAC Name | N-methyl-4-(methylsulfanylmethyl)cyclohexa-1,5-dien-1-amine |
| SMILES | CNC1=CCC(CSC)C=C1 |
| InChI | InChI=1S/C9H15NS/c1-10-9-5-3-8(4-6-9)7-11-2/h3,5-6,8,10H,4,7H2,1-2H3 |
| InChIKey | AMEFAEMFBYMXHZ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.29 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-methyl-4-(methylsulfanylmethyl)cyclohexa-1,5-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-4-(methylsulfanylmethyl)cyclohexa-1,5-dien-1-amine?
The IUPAC name of N-methyl-4-(methylsulfanylmethyl)cyclohexa-1,5-dien-1-amine (CID 166777730) is N-methyl-4-(methylsulfanylmethyl)cyclohexa-1,5-dien-1-amine.
What is the SMILES notation for N-methyl-4-(methylsulfanylmethyl)cyclohexa-1,5-dien-1-amine?
The canonical SMILES for N-methyl-4-(methylsulfanylmethyl)cyclohexa-1,5-dien-1-amine is CNC1=CCC(CSC)C=C1.
What is the InChIKey of N-methyl-4-(methylsulfanylmethyl)cyclohexa-1,5-dien-1-amine?
The InChIKey is AMEFAEMFBYMXHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NS/c1-10-9-5-3-8(4-6-9)7-11-2/h3,5-6,8,10H,4,7H2,1-2H3.
What are the key properties of N-methyl-4-(methylsulfanylmethyl)cyclohexa-1,5-dien-1-amine?
N-methyl-4-(methylsulfanylmethyl)cyclohexa-1,5-dien-1-amine has a molecular weight of 169.29 g/mol, XLogP of 2.03, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-4-(methylsulfanylmethyl)cyclohexa-1,5-dien-1-amine is sourced from PubChem (CID 166777730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).