About (2S)-4-(8-fluoropyrido[3,4-b]pyrazin-5-yl)-2-methyl-6-methylidenemorpholine
(2S)-4-(8-fluoropyrido[3,4-b]pyrazin-5-yl)-2-methyl-6-methylidenemorpholine (PubChem CID 166777893) has the molecular formula C13H13FN4O
and a molecular weight of 260.27 g/mol. Its IUPAC name is (2S)-4-(8-fluoropyrido[3,4-b]pyrazin-5-yl)-2-methyl-6-methylidenemorpholine.
Molecular Properties
| Compound Name | (2S)-4-(8-fluoropyrido[3,4-b]pyrazin-5-yl)-2-methyl-6-methylidenemorpholine |
| PubChem CID | 166777893 |
| Molecular Formula | C13H13FN4O |
| Molecular Weight | 260.27 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | (2S)-4-(8-fluoropyrido[3,4-b]pyrazin-5-yl)-2-methyl-6-methylidenemorpholine |
| SMILES | C=C1CN(c2ncc(F)c3nccnc23)C[C@H](C)O1 |
| InChI | InChI=1S/C13H13FN4O/c1-8-6-18(7-9(2)19-8)13-12-11(10(14)5-17-13)15-3-4-16-12/h3-5,9H,1,6-7H2,2H3/t9-/m0/s1 |
| InChIKey | KBUOGURTJQHGMS-VIFPVBQESA-N |
| XLogP | 1.90 |
| TPSA | 51.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.27 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2S)-4-(8-fluoropyrido[3,4-b]pyrazin-5-yl)-2-methyl-6-methylidenemorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-4-(8-fluoropyrido[3,4-b]pyrazin-5-yl)-2-methyl-6-methylidenemorpholine?
The IUPAC name of (2S)-4-(8-fluoropyrido[3,4-b]pyrazin-5-yl)-2-methyl-6-methylidenemorpholine (CID 166777893) is (2S)-4-(8-fluoropyrido[3,4-b]pyrazin-5-yl)-2-methyl-6-methylidenemorpholine.
What is the SMILES notation for (2S)-4-(8-fluoropyrido[3,4-b]pyrazin-5-yl)-2-methyl-6-methylidenemorpholine?
The canonical SMILES for (2S)-4-(8-fluoropyrido[3,4-b]pyrazin-5-yl)-2-methyl-6-methylidenemorpholine is C=C1CN(c2ncc(F)c3nccnc23)C[C@H](C)O1.
What is the InChIKey of (2S)-4-(8-fluoropyrido[3,4-b]pyrazin-5-yl)-2-methyl-6-methylidenemorpholine?
The InChIKey is KBUOGURTJQHGMS-VIFPVBQESA-N. The full InChI is InChI=1S/C13H13FN4O/c1-8-6-18(7-9(2)19-8)13-12-11(10(14)5-17-13)15-3-4-16-12/h3-5,9H,1,6-7H2,2H3/t9-/m0/s1.
What are the key properties of (2S)-4-(8-fluoropyrido[3,4-b]pyrazin-5-yl)-2-methyl-6-methylidenemorpholine?
(2S)-4-(8-fluoropyrido[3,4-b]pyrazin-5-yl)-2-methyl-6-methylidenemorpholine has a molecular weight of 260.27 g/mol, XLogP of 1.90, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-4-(8-fluoropyrido[3,4-b]pyrazin-5-yl)-2-methyl-6-methylidenemorpholine is sourced from PubChem (CID 166777893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).