C12H18O — CID 166778312
4-[(2Z,4Z)-hepta-2,4,6-trien-3-yl]oxane (PubChem CID 166778312) has the molecular formula C12H18O and a molecular weight of 178.27 g/mol. Its IUPAC name is 4-[(2Z,4Z)-hepta-2,4,6-trien-3-yl]oxane.
| Compound Name | 4-[(2Z,4Z)-hepta-2,4,6-trien-3-yl]oxane |
|---|---|
| PubChem CID | 166778312 |
| Molecular Formula | C12H18O |
| Molecular Weight | 178.27 g/mol |
| Exact Mass | 178.14 |
| IUPAC Name | 4-[(2Z,4Z)-hepta-2,4,6-trien-3-yl]oxane |
| SMILES | C=C/C=C\C(=C/C)C1CCOCC1 |
| InChI | InChI=1S/C12H18O/c1-3-5-6-11(4-2)12-7-9-13-10-8-12/h3-6,12H,1,7-10H2,2H3/b6-5-,11-4+ |
| InChIKey | LCDQSAQIEXLCCI-VWXLBWAMSA-N |
| XLogP | 3.10 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.27 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|