C19H34S — CID 166778345
1-[2-(2,3,4,5,6,7,8,9,10,10a-decahydro-1H-benzo[8]annulen-4a-yl)ethyl]cyclopentane-1-thiol (PubChem CID 166778345) has the molecular formula C19H34S and a molecular weight of 294.55 g/mol. Its IUPAC name is 1-[2-(2,3,4,5,6,7,8,9,10,10a-decahydro-1H-benzo[8]annulen-4a-yl)ethyl]cyclopentane-1-thiol.
| Compound Name | 1-[2-(2,3,4,5,6,7,8,9,10,10a-decahydro-1H-benzo[8]annulen-4a-yl)ethyl]cyclopentane-1-thiol |
|---|---|
| PubChem CID | 166778345 |
| Molecular Formula | C19H34S |
| Molecular Weight | 294.55 g/mol |
| Exact Mass | 294.24 |
| IUPAC Name | 1-[2-(2,3,4,5,6,7,8,9,10,10a-decahydro-1H-benzo[8]annulen-4a-yl)ethyl]cyclopentane-1-thiol |
| SMILES | SC1(CCC23CCCCCCC2CCCC3)CCCC1 |
| InChI | InChI=1S/C19H34S/c20-19(13-7-8-14-19)16-15-18-11-5-2-1-3-9-17(18)10-4-6-12-18/h17,20H,1-16H2 |
| InChIKey | UDUSQCKUZIZDPN-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.55 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|