C21H28N4 — CID 16677840
(3S,8aS)-3-benzyl-2-[(1-ethenyl-5-methylpyrazol-4-yl)methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine (PubChem CID 16677840) has the molecular formula C21H28N4 and a molecular weight of 336.48 g/mol. Its IUPAC name is (3S,8aS)-3-benzyl-2-[(1-ethenyl-5-methylpyrazol-4-yl)methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine.
| Compound Name | (3S,8aS)-3-benzyl-2-[(1-ethenyl-5-methylpyrazol-4-yl)methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 16677840 |
| Molecular Formula | C21H28N4 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | (3S,8aS)-3-benzyl-2-[(1-ethenyl-5-methylpyrazol-4-yl)methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
| SMILES | C=Cn1ncc(CN2C[C@@H]3CCCN3C[C@@H]2Cc2ccccc2)c1C |
| InChI | InChI=1S/C21H28N4/c1-3-25-17(2)19(13-22-25)14-24-15-20-10-7-11-23(20)16-21(24)12-18-8-5-4-6-9-18/h3-6,8-9,13,20-21H,1,7,10-12,14-16H2,2H3/t20-,21-/m0/s1 |
| InChIKey | LKZRMHKLPWTMBV-SFTDATJTSA-N |
| XLogP | 3.18 |
| TPSA | 24.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |