About 2-methyl-5-propan-2-ylidene-1,4-dihydroimidazole
2-methyl-5-propan-2-ylidene-1,4-dihydroimidazole (PubChem CID 166778585) has the molecular formula C7H12N2
and a molecular weight of 124.19 g/mol. Its IUPAC name is 2-methyl-5-propan-2-ylidene-1,4-dihydroimidazole.
Molecular Properties
| Compound Name | 2-methyl-5-propan-2-ylidene-1,4-dihydroimidazole |
| PubChem CID | 166778585 |
| Molecular Formula | C7H12N2 |
| Molecular Weight | 124.19 g/mol |
| Exact Mass | 124.10 |
| IUPAC Name | 2-methyl-5-propan-2-ylidene-1,4-dihydroimidazole |
| SMILES | CC1=NCC(=C(C)C)N1 |
| InChI | InChI=1S/C7H12N2/c1-5(2)7-4-8-6(3)9-7/h4H2,1-3H3,(H,8,9) |
| InChIKey | BWIYTTQLMKTZCW-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.19 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methyl-5-propan-2-ylidene-1,4-dihydroimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-5-propan-2-ylidene-1,4-dihydroimidazole?
The IUPAC name of 2-methyl-5-propan-2-ylidene-1,4-dihydroimidazole (CID 166778585) is 2-methyl-5-propan-2-ylidene-1,4-dihydroimidazole.
What is the SMILES notation for 2-methyl-5-propan-2-ylidene-1,4-dihydroimidazole?
The canonical SMILES for 2-methyl-5-propan-2-ylidene-1,4-dihydroimidazole is CC1=NCC(=C(C)C)N1.
What is the InChIKey of 2-methyl-5-propan-2-ylidene-1,4-dihydroimidazole?
The InChIKey is BWIYTTQLMKTZCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2/c1-5(2)7-4-8-6(3)9-7/h4H2,1-3H3,(H,8,9).
What are the key properties of 2-methyl-5-propan-2-ylidene-1,4-dihydroimidazole?
2-methyl-5-propan-2-ylidene-1,4-dihydroimidazole has a molecular weight of 124.19 g/mol, XLogP of 1.30, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-5-propan-2-ylidene-1,4-dihydroimidazole is sourced from PubChem (CID 166778585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).