C13H17N — CID 166778589
3-ethenyl-1-methyl-3,4,5,9-tetrahydro-2H-cycloocta[b]pyrrole (PubChem CID 166778589) has the molecular formula C13H17N and a molecular weight of 187.29 g/mol. Its IUPAC name is 3-ethenyl-1-methyl-3,4,5,9-tetrahydro-2H-cycloocta[b]pyrrole.
| Compound Name | 3-ethenyl-1-methyl-3,4,5,9-tetrahydro-2H-cycloocta[b]pyrrole |
|---|---|
| PubChem CID | 166778589 |
| Molecular Formula | C13H17N |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | 3-ethenyl-1-methyl-3,4,5,9-tetrahydro-2H-cycloocta[b]pyrrole |
| SMILES | C=CC1CN(C)C2=C1CCC=C=CC2 |
| InChI | InChI=1S/C13H17N/c1-3-11-10-14(2)13-9-7-5-4-6-8-12(11)13/h3-4,7,11H,1,6,8-10H2,2H3 |
| InChIKey | JZFYRFNJTWZULL-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|