C17H30N2 — CID 166778590
(3Z,6Z,8Z)-4-(C,N-dimethylcarbonimidoyl)-7-ethyl-N,N-dimethyldeca-3,6,8-trien-3-amine (PubChem CID 166778590) has the molecular formula C17H30N2 and a molecular weight of 262.44 g/mol. Its IUPAC name is (3Z,6Z,8Z)-4-(C,N-dimethylcarbonimidoyl)-7-ethyl-N,N-dimethyldeca-3,6,8-trien-3-amine.
| Compound Name | (3Z,6Z,8Z)-4-(C,N-dimethylcarbonimidoyl)-7-ethyl-N,N-dimethyldeca-3,6,8-trien-3-amine |
|---|---|
| PubChem CID | 166778590 |
| Molecular Formula | C17H30N2 |
| Molecular Weight | 262.44 g/mol |
| Exact Mass | 262.24 |
| IUPAC Name | (3Z,6Z,8Z)-4-(C,N-dimethylcarbonimidoyl)-7-ethyl-N,N-dimethyldeca-3,6,8-trien-3-amine |
| SMILES | C/C=C\C(=C/CC(=C(\CC)N(C)C)/C(C)=N/C)CC |
| InChI | InChI=1S/C17H30N2/c1-8-11-15(9-2)12-13-16(14(4)18-5)17(10-3)19(6)7/h8,11-12H,9-10,13H2,1-7H3/b11-8-,15-12-,17-16-,18-14+ |
| InChIKey | HRHMKQHTSUBQAU-RKKGAQRQSA-N |
| XLogP | 4.61 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.44 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|