About [3-[2-[4-(3,5-dioxopyrazol-4-yl)phenyl]propyl]-2,5-dioxopyrrolidin-1-yl] 2-methylpropanoate
[3-[2-[4-(3,5-dioxopyrazol-4-yl)phenyl]propyl]-2,5-dioxopyrrolidin-1-yl] 2-methylpropanoate (PubChem CID 166779011) has the molecular formula C20H21N3O6
and a molecular weight of 399.40 g/mol. Its IUPAC name is [3-[2-[4-(3,5-dioxopyrazol-4-yl)phenyl]propyl]-2,5-dioxopyrrolidin-1-yl] 2-methylpropanoate.
Molecular Properties
| Compound Name | [3-[2-[4-(3,5-dioxopyrazol-4-yl)phenyl]propyl]-2,5-dioxopyrrolidin-1-yl] 2-methylpropanoate |
| PubChem CID | 166779011 |
| Molecular Formula | C20H21N3O6 |
| Molecular Weight | 399.40 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | [3-[2-[4-(3,5-dioxopyrazol-4-yl)phenyl]propyl]-2,5-dioxopyrrolidin-1-yl] 2-methylpropanoate |
| SMILES | CC(C)C(=O)ON1C(=O)CC(CC(C)c2ccc(C3C(=O)N=NC3=O)cc2)C1=O |
| InChI | InChI=1S/C20H21N3O6/c1-10(2)20(28)29-23-15(24)9-14(19(23)27)8-11(3)12-4-6-13(7-5-12)16-17(25)21-22-18(16)26/h4-7,10-11,14,16H,8-9H2,1-3H3 |
| InChIKey | STNJHUKQJUXMDY-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 122.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.40 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze [3-[2-[4-(3,5-dioxopyrazol-4-yl)phenyl]propyl]-2,5-dioxopyrrolidin-1-yl] 2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[2-[4-(3,5-dioxopyrazol-4-yl)phenyl]propyl]-2,5-dioxopyrrolidin-1-yl] 2-methylpropanoate?
The IUPAC name of [3-[2-[4-(3,5-dioxopyrazol-4-yl)phenyl]propyl]-2,5-dioxopyrrolidin-1-yl] 2-methylpropanoate (CID 166779011) is [3-[2-[4-(3,5-dioxopyrazol-4-yl)phenyl]propyl]-2,5-dioxopyrrolidin-1-yl] 2-methylpropanoate.
What is the SMILES notation for [3-[2-[4-(3,5-dioxopyrazol-4-yl)phenyl]propyl]-2,5-dioxopyrrolidin-1-yl] 2-methylpropanoate?
The canonical SMILES for [3-[2-[4-(3,5-dioxopyrazol-4-yl)phenyl]propyl]-2,5-dioxopyrrolidin-1-yl] 2-methylpropanoate is CC(C)C(=O)ON1C(=O)CC(CC(C)c2ccc(C3C(=O)N=NC3=O)cc2)C1=O.
What is the InChIKey of [3-[2-[4-(3,5-dioxopyrazol-4-yl)phenyl]propyl]-2,5-dioxopyrrolidin-1-yl] 2-methylpropanoate?
The InChIKey is STNJHUKQJUXMDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21N3O6/c1-10(2)20(28)29-23-15(24)9-14(19(23)27)8-11(3)12-4-6-13(7-5-12)16-17(25)21-22-18(16)26/h4-7,10-11,14,16H,8-9H2,1-3H3.
What are the key properties of [3-[2-[4-(3,5-dioxopyrazol-4-yl)phenyl]propyl]-2,5-dioxopyrrolidin-1-yl] 2-methylpropanoate?
[3-[2-[4-(3,5-dioxopyrazol-4-yl)phenyl]propyl]-2,5-dioxopyrrolidin-1-yl] 2-methylpropanoate has a molecular weight of 399.40 g/mol, XLogP of 2.27, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[2-[4-(3,5-dioxopyrazol-4-yl)phenyl]propyl]-2,5-dioxopyrrolidin-1-yl] 2-methylpropanoate is sourced from PubChem (CID 166779011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).