C29H33FN4O4 — CID 166779149
1-[(2S,4R)-2-[(5R)-5-ethyl-5-[4-(2-fluorophenyl)phenyl]-2H-1,2,4-oxadiazol-3-yl]-4-hydroxypyrrolidin-1-yl]-3-methyl-2-(3-methyl-1,2-oxazol-5-yl)butan-1-one (PubChem CID 166779149) has the molecular formula C29H33FN4O4 and a molecular weight of 520.61 g/mol. Its IUPAC name is 1-[(2S,4R)-2-[(5R)-5-ethyl-5-[4-(2-fluorophenyl)phenyl]-2H-1,2,4-oxadiazol-3-yl]-4-hydroxypyrrolidin-1-yl]-3-methyl-2-(3-methyl-1,2-oxazol-5-yl)butan-1-one.
| Compound Name | 1-[(2S,4R)-2-[(5R)-5-ethyl-5-[4-(2-fluorophenyl)phenyl]-2H-1,2,4-oxadiazol-3-yl]-4-hydroxypyrrolidin-1-yl]-3-methyl-2-(3-methyl-1,2-oxazol-5-yl)butan-1-one |
|---|---|
| PubChem CID | 166779149 |
| Molecular Formula | C29H33FN4O4 |
| Molecular Weight | 520.61 g/mol |
| Exact Mass | 520.25 |
| IUPAC Name | 1-[(2S,4R)-2-[(5R)-5-ethyl-5-[4-(2-fluorophenyl)phenyl]-2H-1,2,4-oxadiazol-3-yl]-4-hydroxypyrrolidin-1-yl]-3-methyl-2-(3-methyl-1,2-oxazol-5-yl)butan-1-one |
| SMILES | CC[C@@]1(c2ccc(-c3ccccc3F)cc2)N=C([C@@H]2C[C@@H](O)CN2C(=O)C(c2cc(C)no2)C(C)C)NO1 |
| InChI | InChI=1S/C29H33FN4O4/c1-5-29(20-12-10-19(11-13-20)22-8-6-7-9-23(22)30)31-27(33-38-29)24-15-21(35)16-34(24)28(36)26(17(2)3)25-14-18(4)32-37-25/h6-14,17,21,24,26,35H,5,15-16H2,1-4H3,(H,31,33)/t21-,24+,26?,29-/m1/s1 |
| InChIKey | KILREDFECIJUHD-HWFPVONRSA-N |
| XLogP | 4.69 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.61 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |