About (4R)-N'-tert-butyl-4-hydroxy-1-[2-(methylaminooxy)propan-2-yl]pyrrolidine-2-carboximidamide
(4R)-N'-tert-butyl-4-hydroxy-1-[2-(methylaminooxy)propan-2-yl]pyrrolidine-2-carboximidamide (PubChem CID 166779164) has the molecular formula C13H28N4O2
and a molecular weight of 272.39 g/mol. Its IUPAC name is (4R)-N'-tert-butyl-4-hydroxy-1-[2-(methylaminooxy)propan-2-yl]pyrrolidine-2-carboximidamide.
Molecular Properties
| Compound Name | (4R)-N'-tert-butyl-4-hydroxy-1-[2-(methylaminooxy)propan-2-yl]pyrrolidine-2-carboximidamide |
| PubChem CID | 166779164 |
| Molecular Formula | C13H28N4O2 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.22 |
| IUPAC Name | (4R)-N'-tert-butyl-4-hydroxy-1-[2-(methylaminooxy)propan-2-yl]pyrrolidine-2-carboximidamide |
| SMILES | CNOC(C)(C)N1C[C@H](O)CC1/C(N)=N/C(C)(C)C |
| InChI | InChI=1S/C13H28N4O2/c1-12(2,3)16-11(14)10-7-9(18)8-17(10)13(4,5)19-15-6/h9-10,15,18H,7-8H2,1-6H3,(H2,14,16)/t9-,10?/m1/s1 |
| InChIKey | WJGYRGCEPPTBNZ-YHMJZVADSA-N |
| XLogP | 0.46 |
| TPSA | 83.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4R)-N'-tert-butyl-4-hydroxy-1-[2-(methylaminooxy)propan-2-yl]pyrrolidine-2-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-N'-tert-butyl-4-hydroxy-1-[2-(methylaminooxy)propan-2-yl]pyrrolidine-2-carboximidamide?
The IUPAC name of (4R)-N'-tert-butyl-4-hydroxy-1-[2-(methylaminooxy)propan-2-yl]pyrrolidine-2-carboximidamide (CID 166779164) is (4R)-N'-tert-butyl-4-hydroxy-1-[2-(methylaminooxy)propan-2-yl]pyrrolidine-2-carboximidamide.
What is the SMILES notation for (4R)-N'-tert-butyl-4-hydroxy-1-[2-(methylaminooxy)propan-2-yl]pyrrolidine-2-carboximidamide?
The canonical SMILES for (4R)-N'-tert-butyl-4-hydroxy-1-[2-(methylaminooxy)propan-2-yl]pyrrolidine-2-carboximidamide is CNOC(C)(C)N1C[C@H](O)CC1/C(N)=N/C(C)(C)C.
What is the InChIKey of (4R)-N'-tert-butyl-4-hydroxy-1-[2-(methylaminooxy)propan-2-yl]pyrrolidine-2-carboximidamide?
The InChIKey is WJGYRGCEPPTBNZ-YHMJZVADSA-N. The full InChI is InChI=1S/C13H28N4O2/c1-12(2,3)16-11(14)10-7-9(18)8-17(10)13(4,5)19-15-6/h9-10,15,18H,7-8H2,1-6H3,(H2,14,16)/t9-,10?/m1/s1.
What are the key properties of (4R)-N'-tert-butyl-4-hydroxy-1-[2-(methylaminooxy)propan-2-yl]pyrrolidine-2-carboximidamide?
(4R)-N'-tert-butyl-4-hydroxy-1-[2-(methylaminooxy)propan-2-yl]pyrrolidine-2-carboximidamide has a molecular weight of 272.39 g/mol, XLogP of 0.46, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-N'-tert-butyl-4-hydroxy-1-[2-(methylaminooxy)propan-2-yl]pyrrolidine-2-carboximidamide is sourced from PubChem (CID 166779164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).