C15H24O2S — CID 166779231
1-tert-butylsulfonyl-3-(2,2-dimethylpropyl)benzene (PubChem CID 166779231) has the molecular formula C15H24O2S and a molecular weight of 268.42 g/mol. Its IUPAC name is 1-tert-butylsulfonyl-3-(2,2-dimethylpropyl)benzene.
| Compound Name | 1-tert-butylsulfonyl-3-(2,2-dimethylpropyl)benzene |
|---|---|
| PubChem CID | 166779231 |
| Molecular Formula | C15H24O2S |
| Molecular Weight | 268.42 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | 1-tert-butylsulfonyl-3-(2,2-dimethylpropyl)benzene |
| SMILES | CC(C)(C)Cc1cccc(S(=O)(=O)C(C)(C)C)c1 |
| InChI | InChI=1S/C15H24O2S/c1-14(2,3)11-12-8-7-9-13(10-12)18(16,17)15(4,5)6/h7-10H,11H2,1-6H3 |
| InChIKey | XNJRSUXOTKLZEA-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.42 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |