C28H44O5 — CID 166779318
(3Z)-4-[(4Z)-7-hydroxy-6-methyl-4-[[(6E)-2-methyl-3a,4,5,8,9,9a-hexahydrocycloocta[d][1,3]dioxol-2-yl]methyl]cyclooct-4-en-1-yl]cyclooct-3-ene-1,2-diol (PubChem CID 166779318) has the molecular formula C28H44O5 and a molecular weight of 460.66 g/mol. Its IUPAC name is (3Z)-4-[(4Z)-7-hydroxy-6-methyl-4-[[(6E)-2-methyl-3a,4,5,8,9,9a-hexahydrocycloocta[d][1,3]dioxol-2-yl]methyl]cyclooct-4-en-1-yl]cyclooct-3-ene-1,2-diol.
| Compound Name | (3Z)-4-[(4Z)-7-hydroxy-6-methyl-4-[[(6E)-2-methyl-3a,4,5,8,9,9a-hexahydrocycloocta[d][1,3]dioxol-2-yl]methyl]cyclooct-4-en-1-yl]cyclooct-3-ene-1,2-diol |
|---|---|
| PubChem CID | 166779318 |
| Molecular Formula | C28H44O5 |
| Molecular Weight | 460.66 g/mol |
| Exact Mass | 460.32 |
| IUPAC Name | (3Z)-4-[(4Z)-7-hydroxy-6-methyl-4-[[(6E)-2-methyl-3a,4,5,8,9,9a-hexahydrocycloocta[d][1,3]dioxol-2-yl]methyl]cyclooct-4-en-1-yl]cyclooct-3-ene-1,2-diol |
| SMILES | CC1/C=C(/CC2(C)OC3CC/C=C\CCC3O2)CCC(/C2=C/C(O)C(O)CCCC2)CC1O |
| InChI | InChI=1S/C28H44O5/c1-19-15-20(18-28(2)32-26-11-5-3-4-6-12-27(26)33-28)13-14-22(16-24(19)30)21-9-7-8-10-23(29)25(31)17-21/h3-4,15,17,19,22-27,29-31H,5-14,16,18H2,1-2H3/b4-3-,20-15+,21-17+ |
| InChIKey | UNNIKMNZOKCESX-YIHXSSOZSA-N |
| XLogP | 4.95 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.66 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|