About 4-methoxy-2,7-dimethyl-2,3-dihydro-1H-azepine
4-methoxy-2,7-dimethyl-2,3-dihydro-1H-azepine (PubChem CID 166779740) has the molecular formula C9H15NO
and a molecular weight of 153.22 g/mol. Its IUPAC name is 4-methoxy-2,7-dimethyl-2,3-dihydro-1H-azepine.
Molecular Properties
| Compound Name | 4-methoxy-2,7-dimethyl-2,3-dihydro-1H-azepine |
| PubChem CID | 166779740 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | 4-methoxy-2,7-dimethyl-2,3-dihydro-1H-azepine |
| SMILES | COC1=CC=C(C)NC(C)C1 |
| InChI | InChI=1S/C9H15NO/c1-7-4-5-9(11-3)6-8(2)10-7/h4-5,8,10H,6H2,1-3H3 |
| InChIKey | AVMAQIFPDBRDCX-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-methoxy-2,7-dimethyl-2,3-dihydro-1H-azepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-2,7-dimethyl-2,3-dihydro-1H-azepine?
The IUPAC name of 4-methoxy-2,7-dimethyl-2,3-dihydro-1H-azepine (CID 166779740) is 4-methoxy-2,7-dimethyl-2,3-dihydro-1H-azepine.
What is the SMILES notation for 4-methoxy-2,7-dimethyl-2,3-dihydro-1H-azepine?
The canonical SMILES for 4-methoxy-2,7-dimethyl-2,3-dihydro-1H-azepine is COC1=CC=C(C)NC(C)C1.
What is the InChIKey of 4-methoxy-2,7-dimethyl-2,3-dihydro-1H-azepine?
The InChIKey is AVMAQIFPDBRDCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO/c1-7-4-5-9(11-3)6-8(2)10-7/h4-5,8,10H,6H2,1-3H3.
What are the key properties of 4-methoxy-2,7-dimethyl-2,3-dihydro-1H-azepine?
4-methoxy-2,7-dimethyl-2,3-dihydro-1H-azepine has a molecular weight of 153.22 g/mol, XLogP of 1.80, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-2,7-dimethyl-2,3-dihydro-1H-azepine is sourced from PubChem (CID 166779740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).