About bis(2-ethylhexyl) decanedioate;dihexyl (E)-but-2-enedioate
bis(2-ethylhexyl) decanedioate;dihexyl (E)-but-2-enedioate (PubChem CID 166779844) has the molecular formula C42H78O8
and a molecular weight of 711.08 g/mol. Its IUPAC name is bis(2-ethylhexyl) decanedioate;dihexyl (E)-but-2-enedioate.
Molecular Properties
| Compound Name | bis(2-ethylhexyl) decanedioate;dihexyl (E)-but-2-enedioate |
| PubChem CID | 166779844 |
| Molecular Formula | C42H78O8 |
| Molecular Weight | 711.08 g/mol |
| Exact Mass | 710.57 |
| IUPAC Name | bis(2-ethylhexyl) decanedioate;dihexyl (E)-but-2-enedioate |
| SMILES | CCCCC(CC)COC(=O)CCCCCCCCC(=O)OCC(CC)CCCC.CCCCCCOC(=O)/C=C/C(=O)OCCCCCC |
| InChI | InChI=1S/C26H50O4.C16H28O4/c1-5-9-17-23(7-3)21-29-25(27)19-15-13-11-12-14-16-20-26(28)30-22-24(8-4)18-10-6-2;1-3-5-7-9-13-19-15(17)11-12-16(18)20-14-10-8-6-4-2/h23-24H,5-22H2,1-4H3;11-12H,3-10,13-14H2,1-2H3/b;12-11+ |
| InChIKey | GGOHXBHBAAFRFC-VPALRPFQSA-N |
| XLogP | 11.42 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 50 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 711.08 |
| LogP ≤ 5 | 11.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze bis(2-ethylhexyl) decanedioate;dihexyl (E)-but-2-enedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-ethylhexyl) decanedioate;dihexyl (E)-but-2-enedioate?
The IUPAC name of bis(2-ethylhexyl) decanedioate;dihexyl (E)-but-2-enedioate (CID 166779844) is bis(2-ethylhexyl) decanedioate;dihexyl (E)-but-2-enedioate.
What is the SMILES notation for bis(2-ethylhexyl) decanedioate;dihexyl (E)-but-2-enedioate?
The canonical SMILES for bis(2-ethylhexyl) decanedioate;dihexyl (E)-but-2-enedioate is CCCCC(CC)COC(=O)CCCCCCCCC(=O)OCC(CC)CCCC.CCCCCCOC(=O)/C=C/C(=O)OCCCCCC.
What is the InChIKey of bis(2-ethylhexyl) decanedioate;dihexyl (E)-but-2-enedioate?
The InChIKey is GGOHXBHBAAFRFC-VPALRPFQSA-N. The full InChI is InChI=1S/C26H50O4.C16H28O4/c1-5-9-17-23(7-3)21-29-25(27)19-15-13-11-12-14-16-20-26(28)30-22-24(8-4)18-10-6-2;1-3-5-7-9-13-19-15(17)11-12-16(18)20-14-10-8-6-4-2/h23-24H,5-22H2,1-4H3;11-12H,3-10,13-14H2,1-2H3/b;12-11+.
What are the key properties of bis(2-ethylhexyl) decanedioate;dihexyl (E)-but-2-enedioate?
bis(2-ethylhexyl) decanedioate;dihexyl (E)-but-2-enedioate has a molecular weight of 711.08 g/mol, XLogP of 11.42, 33 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-ethylhexyl) decanedioate;dihexyl (E)-but-2-enedioate is sourced from PubChem (CID 166779844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).