C54H57Cl2FN6O6 — CID 166779912
CID 166779912 (PubChem CID 166779912) has the molecular formula C54H57Cl2FN6O6 and a molecular weight of 975.99 g/mol.
| Compound Name | CID 166779912 |
|---|---|
| PubChem CID | 166779912 |
| Molecular Formula | C54H57Cl2FN6O6 |
| Molecular Weight | 975.99 g/mol |
| Exact Mass | 974.37 |
| IUPAC Name | — |
| SMILES | CN1[C@@H](C(=O)NC23CCC(C(=O)N4CCC(C#Cc5cccc6c5CN(C5CCC(=O)NC5=O)C6=O)CC4)(CC2)CC3)[C@H](c2cccc(Cl)c2F)[C@@]2(Cc3ccc(Cl)cc3NC2=O)C12CCCCC2 |
| InChI | InChI=1S/C54H57Cl2FN6O6/c1-61-45(43(37-9-6-10-39(56)44(37)57)54(53(61)19-3-2-4-20-53)30-34-13-14-35(55)29-40(34)58-49(54)68)47(66)60-52-24-21-51(22-25-52,23-26-52)50(69)62-27-17-32(18-28-62)11-12-33-7-5-8-36-38(33)31-63(48(36)67)41-15-16-42(64)59-46(41)65/h5-10,13-14,29,32,41,43,45H,2-4,15-28,30-31H2,1H3,(H,58,68)(H,60,66)(H,59,64,65)/t41?,43-,45+,51?,52?,54+/m0/s1 |
| InChIKey | ITTREBWPJBSWKZ-MHXGIYKQSA-N |
| XLogP | 7.67 |
| TPSA | 148.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 975.99 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|