About [(1E)-1-[2-(chloromethyl)-5-cyano-4-methyl-3-pyridinyl]buta-1,3-dien-2-yl] thiohypofluorite
[(1E)-1-[2-(chloromethyl)-5-cyano-4-methyl-3-pyridinyl]buta-1,3-dien-2-yl] thiohypofluorite (PubChem CID 166780091) has the molecular formula C12H10ClFN2S
and a molecular weight of 268.74 g/mol. Its IUPAC name is [(1E)-1-[2-(chloromethyl)-5-cyano-4-methyl-3-pyridinyl]buta-1,3-dien-2-yl] thiohypofluorite.
Molecular Properties
| Compound Name | [(1E)-1-[2-(chloromethyl)-5-cyano-4-methyl-3-pyridinyl]buta-1,3-dien-2-yl] thiohypofluorite |
| PubChem CID | 166780091 |
| Molecular Formula | C12H10ClFN2S |
| Molecular Weight | 268.74 g/mol |
| Exact Mass | 268.02 |
| IUPAC Name | [(1E)-1-[2-(chloromethyl)-5-cyano-4-methyl-3-pyridinyl]buta-1,3-dien-2-yl] thiohypofluorite |
| SMILES | C=C/C(=C\c1c(CCl)ncc(C#N)c1C)SF |
| InChI | InChI=1S/C12H10ClFN2S/c1-3-10(17-14)4-11-8(2)9(6-15)7-16-12(11)5-13/h3-4,7H,1,5H2,2H3/b10-4+ |
| InChIKey | PSIALMSRRPKUPV-ONNFQVAWSA-N |
| XLogP | 4.15 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.74 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [(1E)-1-[2-(chloromethyl)-5-cyano-4-methyl-3-pyridinyl]buta-1,3-dien-2-yl] thiohypofluorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1E)-1-[2-(chloromethyl)-5-cyano-4-methyl-3-pyridinyl]buta-1,3-dien-2-yl] thiohypofluorite?
The IUPAC name of [(1E)-1-[2-(chloromethyl)-5-cyano-4-methyl-3-pyridinyl]buta-1,3-dien-2-yl] thiohypofluorite (CID 166780091) is [(1E)-1-[2-(chloromethyl)-5-cyano-4-methyl-3-pyridinyl]buta-1,3-dien-2-yl] thiohypofluorite.
What is the SMILES notation for [(1E)-1-[2-(chloromethyl)-5-cyano-4-methyl-3-pyridinyl]buta-1,3-dien-2-yl] thiohypofluorite?
The canonical SMILES for [(1E)-1-[2-(chloromethyl)-5-cyano-4-methyl-3-pyridinyl]buta-1,3-dien-2-yl] thiohypofluorite is C=C/C(=C\c1c(CCl)ncc(C#N)c1C)SF.
What is the InChIKey of [(1E)-1-[2-(chloromethyl)-5-cyano-4-methyl-3-pyridinyl]buta-1,3-dien-2-yl] thiohypofluorite?
The InChIKey is PSIALMSRRPKUPV-ONNFQVAWSA-N. The full InChI is InChI=1S/C12H10ClFN2S/c1-3-10(17-14)4-11-8(2)9(6-15)7-16-12(11)5-13/h3-4,7H,1,5H2,2H3/b10-4+.
What are the key properties of [(1E)-1-[2-(chloromethyl)-5-cyano-4-methyl-3-pyridinyl]buta-1,3-dien-2-yl] thiohypofluorite?
[(1E)-1-[2-(chloromethyl)-5-cyano-4-methyl-3-pyridinyl]buta-1,3-dien-2-yl] thiohypofluorite has a molecular weight of 268.74 g/mol, XLogP of 4.15, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(1E)-1-[2-(chloromethyl)-5-cyano-4-methyl-3-pyridinyl]buta-1,3-dien-2-yl] thiohypofluorite is sourced from PubChem (CID 166780091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).