About 4-fluoro-N,3-dimethyl-N-[(2E)-penta-2,4-dien-2-yl]aniline
4-fluoro-N,3-dimethyl-N-[(2E)-penta-2,4-dien-2-yl]aniline (PubChem CID 166780248) has the molecular formula C13H16FN
and a molecular weight of 205.28 g/mol. Its IUPAC name is 4-fluoro-N,3-dimethyl-N-[(2E)-penta-2,4-dien-2-yl]aniline.
Molecular Properties
| Compound Name | 4-fluoro-N,3-dimethyl-N-[(2E)-penta-2,4-dien-2-yl]aniline |
| PubChem CID | 166780248 |
| Molecular Formula | C13H16FN |
| Molecular Weight | 205.28 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | 4-fluoro-N,3-dimethyl-N-[(2E)-penta-2,4-dien-2-yl]aniline |
| SMILES | C=C/C=C(\C)N(C)c1ccc(F)c(C)c1 |
| InChI | InChI=1S/C13H16FN/c1-5-6-11(3)15(4)12-7-8-13(14)10(2)9-12/h5-9H,1H2,2-4H3/b11-6+ |
| InChIKey | LXLQOKIPRIVIDW-IZZDOVSWSA-N |
| XLogP | 3.66 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.28 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-fluoro-N,3-dimethyl-N-[(2E)-penta-2,4-dien-2-yl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-N,3-dimethyl-N-[(2E)-penta-2,4-dien-2-yl]aniline?
The IUPAC name of 4-fluoro-N,3-dimethyl-N-[(2E)-penta-2,4-dien-2-yl]aniline (CID 166780248) is 4-fluoro-N,3-dimethyl-N-[(2E)-penta-2,4-dien-2-yl]aniline.
What is the SMILES notation for 4-fluoro-N,3-dimethyl-N-[(2E)-penta-2,4-dien-2-yl]aniline?
The canonical SMILES for 4-fluoro-N,3-dimethyl-N-[(2E)-penta-2,4-dien-2-yl]aniline is C=C/C=C(\C)N(C)c1ccc(F)c(C)c1.
What is the InChIKey of 4-fluoro-N,3-dimethyl-N-[(2E)-penta-2,4-dien-2-yl]aniline?
The InChIKey is LXLQOKIPRIVIDW-IZZDOVSWSA-N. The full InChI is InChI=1S/C13H16FN/c1-5-6-11(3)15(4)12-7-8-13(14)10(2)9-12/h5-9H,1H2,2-4H3/b11-6+.
What are the key properties of 4-fluoro-N,3-dimethyl-N-[(2E)-penta-2,4-dien-2-yl]aniline?
4-fluoro-N,3-dimethyl-N-[(2E)-penta-2,4-dien-2-yl]aniline has a molecular weight of 205.28 g/mol, XLogP of 3.66, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-N,3-dimethyl-N-[(2E)-penta-2,4-dien-2-yl]aniline is sourced from PubChem (CID 166780248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).