C14H13FN2O3 — CID 166780361
7-[2-(3-fluorooxetan-3-yl)ethynyl]-5-methyl-2,3-dihydropyrido[3,2-b][1,4]oxazepin-4-one (PubChem CID 166780361) has the molecular formula C14H13FN2O3 and a molecular weight of 276.27 g/mol. Its IUPAC name is 7-[2-(3-fluorooxetan-3-yl)ethynyl]-5-methyl-2,3-dihydropyrido[3,2-b][1,4]oxazepin-4-one.
| Compound Name | 7-[2-(3-fluorooxetan-3-yl)ethynyl]-5-methyl-2,3-dihydropyrido[3,2-b][1,4]oxazepin-4-one |
|---|---|
| PubChem CID | 166780361 |
| Molecular Formula | C14H13FN2O3 |
| Molecular Weight | 276.27 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | 7-[2-(3-fluorooxetan-3-yl)ethynyl]-5-methyl-2,3-dihydropyrido[3,2-b][1,4]oxazepin-4-one |
| SMILES | CN1C(=O)CCOc2ccc(C#CC3(F)COC3)nc21 |
| InChI | InChI=1S/C14H13FN2O3/c1-17-12(18)5-7-20-11-3-2-10(16-13(11)17)4-6-14(15)8-19-9-14/h2-3H,5,7-9H2,1H3 |
| InChIKey | YOEZVCIRGUKTSU-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.27 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|