About 1-[(3Z)-hexa-1,3-dien-2-yl]-2-methylhydrazine
1-[(3Z)-hexa-1,3-dien-2-yl]-2-methylhydrazine (PubChem CID 166780932) has the molecular formula C7H14N2
and a molecular weight of 126.20 g/mol. Its IUPAC name is 1-[(3Z)-hexa-1,3-dien-2-yl]-2-methylhydrazine.
Molecular Properties
| Compound Name | 1-[(3Z)-hexa-1,3-dien-2-yl]-2-methylhydrazine |
| PubChem CID | 166780932 |
| Molecular Formula | C7H14N2 |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.12 |
| IUPAC Name | 1-[(3Z)-hexa-1,3-dien-2-yl]-2-methylhydrazine |
| SMILES | C=C(/C=C\CC)NNC |
| InChI | InChI=1S/C7H14N2/c1-4-5-6-7(2)9-8-3/h5-6,8-9H,2,4H2,1,3H3/b6-5- |
| InChIKey | JWQXIPRRNFDPDJ-WAYWQWQTSA-N |
| XLogP | 1.19 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(3Z)-hexa-1,3-dien-2-yl]-2-methylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3Z)-hexa-1,3-dien-2-yl]-2-methylhydrazine?
The IUPAC name of 1-[(3Z)-hexa-1,3-dien-2-yl]-2-methylhydrazine (CID 166780932) is 1-[(3Z)-hexa-1,3-dien-2-yl]-2-methylhydrazine.
What is the SMILES notation for 1-[(3Z)-hexa-1,3-dien-2-yl]-2-methylhydrazine?
The canonical SMILES for 1-[(3Z)-hexa-1,3-dien-2-yl]-2-methylhydrazine is C=C(/C=C\CC)NNC.
What is the InChIKey of 1-[(3Z)-hexa-1,3-dien-2-yl]-2-methylhydrazine?
The InChIKey is JWQXIPRRNFDPDJ-WAYWQWQTSA-N. The full InChI is InChI=1S/C7H14N2/c1-4-5-6-7(2)9-8-3/h5-6,8-9H,2,4H2,1,3H3/b6-5-.
What are the key properties of 1-[(3Z)-hexa-1,3-dien-2-yl]-2-methylhydrazine?
1-[(3Z)-hexa-1,3-dien-2-yl]-2-methylhydrazine has a molecular weight of 126.20 g/mol, XLogP of 1.19, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3Z)-hexa-1,3-dien-2-yl]-2-methylhydrazine is sourced from PubChem (CID 166780932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).