About N-buta-1,3-dien-2-yloxan-4-amine
N-buta-1,3-dien-2-yloxan-4-amine (PubChem CID 166781018) has the molecular formula C9H15NO
and a molecular weight of 153.22 g/mol. Its IUPAC name is N-buta-1,3-dien-2-yloxan-4-amine.
Molecular Properties
| Compound Name | N-buta-1,3-dien-2-yloxan-4-amine |
| PubChem CID | 166781018 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | N-buta-1,3-dien-2-yloxan-4-amine |
| SMILES | C=CC(=C)NC1CCOCC1 |
| InChI | InChI=1S/C9H15NO/c1-3-8(2)10-9-4-6-11-7-5-9/h3,9-10H,1-2,4-7H2 |
| InChIKey | HTRNUAFCKQXPCC-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-buta-1,3-dien-2-yloxan-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-buta-1,3-dien-2-yloxan-4-amine?
The IUPAC name of N-buta-1,3-dien-2-yloxan-4-amine (CID 166781018) is N-buta-1,3-dien-2-yloxan-4-amine.
What is the SMILES notation for N-buta-1,3-dien-2-yloxan-4-amine?
The canonical SMILES for N-buta-1,3-dien-2-yloxan-4-amine is C=CC(=C)NC1CCOCC1.
What is the InChIKey of N-buta-1,3-dien-2-yloxan-4-amine?
The InChIKey is HTRNUAFCKQXPCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO/c1-3-8(2)10-9-4-6-11-7-5-9/h3,9-10H,1-2,4-7H2.
What are the key properties of N-buta-1,3-dien-2-yloxan-4-amine?
N-buta-1,3-dien-2-yloxan-4-amine has a molecular weight of 153.22 g/mol, XLogP of 1.45, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-buta-1,3-dien-2-yloxan-4-amine is sourced from PubChem (CID 166781018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).