C19H27FN4O3 — CID 166781066
5-[3-[[(3S)-4-(3-fluorophenyl)-3-methylpiperazin-1-yl]methoxy]propyl]-5-methylimidazolidine-2,4-dione (PubChem CID 166781066) has the molecular formula C19H27FN4O3 and a molecular weight of 378.45 g/mol. Its IUPAC name is 5-[3-[[(3S)-4-(3-fluorophenyl)-3-methylpiperazin-1-yl]methoxy]propyl]-5-methylimidazolidine-2,4-dione.
| Compound Name | 5-[3-[[(3S)-4-(3-fluorophenyl)-3-methylpiperazin-1-yl]methoxy]propyl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 166781066 |
| Molecular Formula | C19H27FN4O3 |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.21 |
| IUPAC Name | 5-[3-[[(3S)-4-(3-fluorophenyl)-3-methylpiperazin-1-yl]methoxy]propyl]-5-methylimidazolidine-2,4-dione |
| SMILES | C[C@H]1CN(COCCCC2(C)NC(=O)NC2=O)CCN1c1cccc(F)c1 |
| InChI | InChI=1S/C19H27FN4O3/c1-14-12-23(8-9-24(14)16-6-3-5-15(20)11-16)13-27-10-4-7-19(2)17(25)21-18(26)22-19/h3,5-6,11,14H,4,7-10,12-13H2,1-2H3,(H2,21,22,25,26)/t14-,19?/m0/s1 |
| InChIKey | HMCPYLPWWHVKOA-KTQQKIMGSA-N |
| XLogP | 1.69 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|