C22H30ClFN4O3 — CID 166781165
5-[3-[(3S)-4-[(3E,5Z)-5-chloro-6-fluorohepta-1,3,5-trien-3-yl]-3-methylpiperazin-1-yl]-2-methyl-3-oxopropyl]-5-cyclopropylimidazolidine-2,4-dione (PubChem CID 166781165) has the molecular formula C22H30ClFN4O3 and a molecular weight of 452.96 g/mol. Its IUPAC name is 5-[3-[(3S)-4-[(3E,5Z)-5-chloro-6-fluorohepta-1,3,5-trien-3-yl]-3-methylpiperazin-1-yl]-2-methyl-3-oxopropyl]-5-cyclopropylimidazolidine-2,4-dione.
| Compound Name | 5-[3-[(3S)-4-[(3E,5Z)-5-chloro-6-fluorohepta-1,3,5-trien-3-yl]-3-methylpiperazin-1-yl]-2-methyl-3-oxopropyl]-5-cyclopropylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 166781165 |
| Molecular Formula | C22H30ClFN4O3 |
| Molecular Weight | 452.96 g/mol |
| Exact Mass | 452.20 |
| IUPAC Name | 5-[3-[(3S)-4-[(3E,5Z)-5-chloro-6-fluorohepta-1,3,5-trien-3-yl]-3-methylpiperazin-1-yl]-2-methyl-3-oxopropyl]-5-cyclopropylimidazolidine-2,4-dione |
| SMILES | C=C/C(=C\C(Cl)=C(/C)F)N1CCN(C(=O)C(C)CC2(C3CC3)NC(=O)NC2=O)C[C@@H]1C |
| InChI | InChI=1S/C22H30ClFN4O3/c1-5-17(10-18(23)15(4)24)28-9-8-27(12-14(28)3)19(29)13(2)11-22(16-6-7-16)20(30)25-21(31)26-22/h5,10,13-14,16H,1,6-9,11-12H2,2-4H3,(H2,25,26,30,31)/b17-10+,18-15-/t13?,14-,22?/m0/s1 |
| InChIKey | DDEXROFOYZOJSD-AOKPNODBSA-N |
| XLogP | 3.04 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.96 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|